Filtered Search Results
| CAS | 11128-95-3 |
|---|---|
| MDL Number | MFCD00145822 |
Molecular Sieve Type 4A, Technical, 1.6-2.5 mm Beads (8-12 Mesh), Fisher Chemical™
CAS: 70955-01-0 Molecular Formula: C20H25FN2O8 Molecular Weight (g/mol): 440.42 MDL Number: MFCD00131613 InChI Key: FJUZEZRZKVMAMD-UHFFFAOYNA-N PubChem CID: 73906282 IUPAC Name: Molecular sieves SMILES: COC(=O)C(C(C)C(NC(=O)C(CC1=CC(F)=CC=C1)NC(C)=O)C(O)=O)C(=O)OC
| PubChem CID | 73906282 |
|---|---|
| CAS | 70955-01-0 |
| Molecular Weight (g/mol) | 440.42 |
| MDL Number | MFCD00131613 |
| SMILES | COC(=O)C(C(C)C(NC(=O)C(CC1=CC(F)=CC=C1)NC(C)=O)C(O)=O)C(=O)OC |
| IUPAC Name | Molecular sieves |
| InChI Key | FJUZEZRZKVMAMD-UHFFFAOYNA-N |
| Molecular Formula | C20H25FN2O8 |
AmberChrom™, 50WX8 200-400 (H)
CAS: 11119-67-8 MDL Number: MFCD00132726 IUPAC Name: AmberChrom™ 50WX8 Ion Exchange Resin
| CAS | 11119-67-8 |
|---|---|
| MDL Number | MFCD00132726 |
| IUPAC Name | AmberChrom™ 50WX8 Ion Exchange Resin |
Molecular sieves, 3A, 2-5 mm (0.08-0.20in) beads
CAS: 308080-99-1 Molecular Formula: AlNaO6Si2 Molecular Weight (g/mol): 202.135 MDL Number: MFCD00131613 InChI Key: URGAHOPLAPQHLN-UHFFFAOYSA-N PubChem CID: 19758701 IUPAC Name: aluminum;sodium;dioxido(oxo)silane SMILES: [O-][Si](=O)[O-].[O-][Si](=O)[O-].[Na+].[Al+3]
| PubChem CID | 19758701 |
|---|---|
| CAS | 308080-99-1 |
| Molecular Weight (g/mol) | 202.135 |
| MDL Number | MFCD00131613 |
| SMILES | [O-][Si](=O)[O-].[O-][Si](=O)[O-].[Na+].[Al+3] |
| IUPAC Name | aluminum;sodium;dioxido(oxo)silane |
| InChI Key | URGAHOPLAPQHLN-UHFFFAOYSA-N |
| Molecular Formula | AlNaO6Si2 |
Amberlite™ IRN-150, ion exchange resin
Styrene-DVB; Mix of strongly acidic and basic gel type resin | Styrene-DVB
| Health Hazard 3 | P280-P305+P351+P338-P310 |
|---|---|
| MDL Number | MFCD00145822 |
| Solubility Information | Insoluble in water,acids and bases. |
| Health Hazard 1 | H318 |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
| Molecular Formula | Styrene-DVB |
| Odor | Odorless |
Amberlyst™ 15(H), wet, ion exchange resin
CAS: 39389-20-3 Molecular Formula: C18H18O3S Molecular Weight (g/mol): 314.399 MDL Number: MFCD00145841 InChI Key: SIWVGXQOXWGJCI-UHFFFAOYSA-N Synonym: amberlyst 15, wet, ion exchange resin,2-ethenylbenzenesulfonic acid; divinylbenzene,benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene,ksc581g2r,amberlyst 15 ion-exchange resin,amberlite? ir120 hydrogen form,2-ethenylbenzenesulfonic acid-1,2-diethenylbenzene 1:1,amberlite r ir120 hydrogen form,divinylbenzene-styrenesulfonic acid copolymer,1,2-bis ethenyl benzene; 2-ethenylbenzenesulfonic acid PubChem CID: 170197 IUPAC Name: 1,2-bis(ethenyl)benzene;2-ethenylbenzenesulfonic acid SMILES: C=CC1=CC=CC=C1C=C.C=CC1=CC=CC=C1S(=O)(=O)O
| PubChem CID | 170197 |
|---|---|
| CAS | 39389-20-3 |
| Molecular Weight (g/mol) | 314.399 |
| MDL Number | MFCD00145841 |
| SMILES | C=CC1=CC=CC=C1C=C.C=CC1=CC=CC=C1S(=O)(=O)O |
| Synonym | amberlyst 15, wet, ion exchange resin,2-ethenylbenzenesulfonic acid; divinylbenzene,benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene,ksc581g2r,amberlyst 15 ion-exchange resin,amberlite? ir120 hydrogen form,2-ethenylbenzenesulfonic acid-1,2-diethenylbenzene 1:1,amberlite r ir120 hydrogen form,divinylbenzene-styrenesulfonic acid copolymer,1,2-bis ethenyl benzene; 2-ethenylbenzenesulfonic acid |
| IUPAC Name | 1,2-bis(ethenyl)benzene;2-ethenylbenzenesulfonic acid |
| InChI Key | SIWVGXQOXWGJCI-UHFFFAOYSA-N |
| Molecular Formula | C18H18O3S |
Molecular sieves, 4A, -8+12 (ca 2mm) beads
CAS: 70955-01-0 Molecular Formula: C20H25FN2O8 Molecular Weight (g/mol): 440.42 MDL Number: MFCD00131613 InChI Key: FJUZEZRZKVMAMD-UHFFFAOYNA-N PubChem CID: 73906282 IUPAC Name: (2R,3S)-2-[[(2R)-2-acetamido-3-(3-fluorophenyl)propanoyl]amino]-5-methoxy-4-methoxycarbonyl-3-methyl-5-oxopentanoic acid SMILES: COC(=O)C(C(C)C(NC(=O)C(CC1=CC(F)=CC=C1)NC(C)=O)C(O)=O)C(=O)OC
| PubChem CID | 73906282 |
|---|---|
| CAS | 70955-01-0 |
| Molecular Weight (g/mol) | 440.42 |
| MDL Number | MFCD00131613 |
| SMILES | COC(=O)C(C(C)C(NC(=O)C(CC1=CC(F)=CC=C1)NC(C)=O)C(O)=O)C(=O)OC |
| IUPAC Name | (2R,3S)-2-[[(2R)-2-acetamido-3-(3-fluorophenyl)propanoyl]amino]-5-methoxy-4-methoxycarbonyl-3-methyl-5-oxopentanoic acid |
| InChI Key | FJUZEZRZKVMAMD-UHFFFAOYNA-N |
| Molecular Formula | C20H25FN2O8 |
Molecular sieves, 4A, powder
CAS: 70955-01-0 Molecular Formula: C20H25FN2O8 Molecular Weight (g/mol): 440.42 MDL Number: MFCD00131613 InChI Key: FJUZEZRZKVMAMD-UHFFFAOYNA-N PubChem CID: 73906282 IUPAC Name: (2R,3S)-2-[[(2R)-2-acetamido-3-(3-fluorophenyl)propanoyl]amino]-5-methoxy-4-methoxycarbonyl-3-methyl-5-oxopentanoic acid SMILES: COC(=O)C(C(C)C(NC(=O)C(CC1=CC(F)=CC=C1)NC(C)=O)C(O)=O)C(=O)OC
| PubChem CID | 73906282 |
|---|---|
| CAS | 70955-01-0 |
| Molecular Weight (g/mol) | 440.42 |
| MDL Number | MFCD00131613 |
| SMILES | COC(=O)C(C(C)C(NC(=O)C(CC1=CC(F)=CC=C1)NC(C)=O)C(O)=O)C(=O)OC |
| IUPAC Name | (2R,3S)-2-[[(2R)-2-acetamido-3-(3-fluorophenyl)propanoyl]amino]-5-methoxy-4-methoxycarbonyl-3-methyl-5-oxopentanoic acid |
| InChI Key | FJUZEZRZKVMAMD-UHFFFAOYNA-N |
| Molecular Formula | C20H25FN2O8 |
Molecular sieves, 3A, powder
CAS: 308080-99-1 Molecular Formula: AlNaO6Si2 Molecular Weight (g/mol): 202.135 MDL Number: MFCD00131613 InChI Key: URGAHOPLAPQHLN-UHFFFAOYSA-N PubChem CID: 19758701 SMILES: [O-][Si](=O)[O-].[O-][Si](=O)[O-].[Na+].[Al+3]
| PubChem CID | 19758701 |
|---|---|
| CAS | 308080-99-1 |
| Molecular Weight (g/mol) | 202.135 |
| MDL Number | MFCD00131613 |
| SMILES | [O-][Si](=O)[O-].[O-][Si](=O)[O-].[Na+].[Al+3] |
| InChI Key | URGAHOPLAPQHLN-UHFFFAOYSA-N |
| Molecular Formula | AlNaO6Si2 |
HYDRANAL™-Molecular sieve 0.3 nm, Honeywell Fluka™
Drying agent for air and gases for Karl Fischer titration
Molecular sieves, Honeywell Fluka™
CAS: 308080-99-1 Molecular Formula: AlNaO6Si2 Molecular Weight (g/mol): 202.135 MDL Number: MFCD00131613 InChI Key: URGAHOPLAPQHLN-UHFFFAOYSA-N PubChem CID: 19758701 IUPAC Name: aluminum;sodium;dioxido(oxo)silane SMILES: [O-][Si](=O)[O-].[O-][Si](=O)[O-].[Na+].[Al+3]
| PubChem CID | 19758701 |
|---|---|
| CAS | 308080-99-1 |
| Molecular Weight (g/mol) | 202.135 |
| MDL Number | MFCD00131613 |
| SMILES | [O-][Si](=O)[O-].[O-][Si](=O)[O-].[Na+].[Al+3] |
| IUPAC Name | aluminum;sodium;dioxido(oxo)silane |
| InChI Key | URGAHOPLAPQHLN-UHFFFAOYSA-N |
| Molecular Formula | AlNaO6Si2 |
Molecular sieves 4A, 8 to 12 mesh
CAS: 70955-01-0 Molecular Formula: C20H25FN2O8 Molecular Weight (g/mol): 440.42 MDL Number: MFCD00131613 InChI Key: FJUZEZRZKVMAMD-UHFFFAOYNA-N PubChem CID: 73906282 SMILES: COC(=O)C(C(C)C(NC(=O)C(CC1=CC(F)=CC=C1)NC(C)=O)C(O)=O)C(=O)OC
| PubChem CID | 73906282 |
|---|---|
| CAS | 70955-01-0 |
| Molecular Weight (g/mol) | 440.42 |
| MDL Number | MFCD00131613 |
| SMILES | COC(=O)C(C(C)C(NC(=O)C(CC1=CC(F)=CC=C1)NC(C)=O)C(O)=O)C(=O)OC |
| InChI Key | FJUZEZRZKVMAMD-UHFFFAOYNA-N |
| Molecular Formula | C20H25FN2O8 |
Amberlite™ IRC-120(H), ion exchange resin
CAS: 78922-04-0 Molecular Formula: C13H10ClNO4S Molecular Weight (g/mol): 311.736 MDL Number: MFCD00132707 InChI Key: APBOVLPLJFJSRI-UHFFFAOYSA-N Synonym: 3-3-chlorophenylsulfonamido benzoic acid,3-3-chloro-benzenesulfonylamino-benzoic acid,3-3-chlorophenyl sulfonyl amino benzoic acid,benzoicacid, 3-3-chlorophenyl sulfonyl amino,3-3-chlorobenzenesulfonamido benzoic acid,amberlite ir-120,3-3-chlorophenyl sulfonylamino benzoic acid,3-3-chlorophenyl sulfonamido benzoic acid PubChem CID: 8190984 IUPAC Name: 3-[(3-chlorophenyl)sulfonylamino]benzoic acid SMILES: C1=CC(=CC(=C1)NS(=O)(=O)C2=CC(=CC=C2)Cl)C(=O)O
| PubChem CID | 8190984 |
|---|---|
| CAS | 78922-04-0 |
| Molecular Weight (g/mol) | 311.736 |
| MDL Number | MFCD00132707 |
| SMILES | C1=CC(=CC(=C1)NS(=O)(=O)C2=CC(=CC=C2)Cl)C(=O)O |
| Synonym | 3-3-chlorophenylsulfonamido benzoic acid,3-3-chloro-benzenesulfonylamino-benzoic acid,3-3-chlorophenyl sulfonyl amino benzoic acid,benzoicacid, 3-3-chlorophenyl sulfonyl amino,3-3-chlorobenzenesulfonamido benzoic acid,amberlite ir-120,3-3-chlorophenyl sulfonylamino benzoic acid,3-3-chlorophenyl sulfonamido benzoic acid |
| IUPAC Name | 3-[(3-chlorophenyl)sulfonylamino]benzoic acid |
| InChI Key | APBOVLPLJFJSRI-UHFFFAOYSA-N |
| Molecular Formula | C13H10ClNO4S |
Molecular sieves 3A, 8 to 12 mesh
CAS: 308080-99-1 Molecular Formula: AlNaO6Si2 Molecular Weight (g/mol): 202.135 MDL Number: MFCD00131613 InChI Key: URGAHOPLAPQHLN-UHFFFAOYSA-N PubChem CID: 19758701 IUPAC Name: aluminum;sodium;dioxido(oxo)silane SMILES: [O-][Si](=O)[O-].[O-][Si](=O)[O-].[Na+].[Al+3]
| PubChem CID | 19758701 |
|---|---|
| CAS | 308080-99-1 |
| Molecular Weight (g/mol) | 202.135 |
| MDL Number | MFCD00131613 |
| SMILES | [O-][Si](=O)[O-].[O-][Si](=O)[O-].[Na+].[Al+3] |
| IUPAC Name | aluminum;sodium;dioxido(oxo)silane |
| InChI Key | URGAHOPLAPQHLN-UHFFFAOYSA-N |
| Molecular Formula | AlNaO6Si2 |