Benzenoids
Filtered Search Results
AL 8697, MedChemExpress
MedChemExpress AL 8697 is a specific and orally active p38α MAPK inhibitor with an IC50 of 6 nM. AL 8697 displays 14-fold greater inhibition of p38α compared to p38β (IC50=82 nM), and 300-fold selectivity for p38α over a panel of 91 kinases. Anti-inflammatory activity.
Non-distribution item offered as a customer accommodation; additional freight charges may apply.
Learn More
Methyl 3-fluoro-4-methoxybenzoate, 95%, Thermo Scientific™
CAS: 369-30-2 Molecular Formula: C9H9FO3 Molecular Weight (g/mol): 184.17 MDL Number: MFCD00215839 InChI Key: MIKOKYAREMINFF-UHFFFAOYSA-N Synonym: benzoic acid, 3-fluoro-4-methoxy-, methyl ester,methyl 3-fluoro-4-methyloxy benzoate,3-fluoro-4-methoxybenzoic acid methyl ester,pubchem3569,acmc-1ck9v,rarechem al bf 0055,# PubChem CID: 592848 IUPAC Name: methyl 3-fluoro-4-methoxybenzoate SMILES: COC(=O)C1=CC(F)=C(OC)C=C1
| PubChem CID | 592848 |
|---|---|
| CAS | 369-30-2 |
| Molecular Weight (g/mol) | 184.17 |
| MDL Number | MFCD00215839 |
| SMILES | COC(=O)C1=CC(F)=C(OC)C=C1 |
| Synonym | benzoic acid, 3-fluoro-4-methoxy-, methyl ester,methyl 3-fluoro-4-methyloxy benzoate,3-fluoro-4-methoxybenzoic acid methyl ester,pubchem3569,acmc-1ck9v,rarechem al bf 0055,# |
| IUPAC Name | methyl 3-fluoro-4-methoxybenzoate |
| InChI Key | MIKOKYAREMINFF-UHFFFAOYSA-N |
| Molecular Formula | C9H9FO3 |
4-Amino-3-(trifluoromethoxy)benzoic acid, 95%, Thermo Scientific™
CAS: 175278-22-5 Molecular Formula: C8H6F3NO3 Molecular Weight (g/mol): 221.135 InChI Key: IXJFWBNYFTWBOR-UHFFFAOYSA-N Synonym: 4-amino-3-trifluoromethoxy benzoic acid,rarechem al bo 0798,buttpark 83\07-32,4-amino-3-trifluoromethoxy-benzoic acid,4-amine-3-trifluoromethoxy benzoic acid,benzoic acid, 4-amino-3-trifluoromethoxy,4-amino-3-trifluoromethoxybenzoicacid,pubchem14042,acmc-209e9s PubChem CID: 2735951 IUPAC Name: 4-amino-3-(trifluoromethoxy)benzoic acid SMILES: C1=CC(=C(C=C1C(=O)O)OC(F)(F)F)N
| PubChem CID | 2735951 |
|---|---|
| CAS | 175278-22-5 |
| Molecular Weight (g/mol) | 221.135 |
| SMILES | C1=CC(=C(C=C1C(=O)O)OC(F)(F)F)N |
| Synonym | 4-amino-3-trifluoromethoxy benzoic acid,rarechem al bo 0798,buttpark 83\07-32,4-amino-3-trifluoromethoxy-benzoic acid,4-amine-3-trifluoromethoxy benzoic acid,benzoic acid, 4-amino-3-trifluoromethoxy,4-amino-3-trifluoromethoxybenzoicacid,pubchem14042,acmc-209e9s |
| IUPAC Name | 4-amino-3-(trifluoromethoxy)benzoic acid |
| InChI Key | IXJFWBNYFTWBOR-UHFFFAOYSA-N |
| Molecular Formula | C8H6F3NO3 |
Ethyl 3-chlorobenzoate, 98+%
CAS: 1128-76-3 Molecular Formula: C9H9ClO2 Molecular Weight (g/mol): 184.619 MDL Number: MFCD00013634 InChI Key: LVFRSNCBCHABAM-UHFFFAOYSA-N Synonym: benzoic acid, 3-chloro-, ethyl ester,3-chlorobenzoic acid ethyl ester,ethyl m-chlorobenzoate,benzoic acid, m-chloro-, ethyl ester,3-chloro-benzoic acid ethyl ester,pubchem3704,acmc-1bt4u,ethyl3-chlorobenzoate,ksc495m6f,rarechem al bi 0056 PubChem CID: 70785 IUPAC Name: ethyl 3-chlorobenzoate SMILES: CCOC(=O)C1=CC(=CC=C1)Cl
| PubChem CID | 70785 |
|---|---|
| CAS | 1128-76-3 |
| Molecular Weight (g/mol) | 184.619 |
| MDL Number | MFCD00013634 |
| SMILES | CCOC(=O)C1=CC(=CC=C1)Cl |
| Synonym | benzoic acid, 3-chloro-, ethyl ester,3-chlorobenzoic acid ethyl ester,ethyl m-chlorobenzoate,benzoic acid, m-chloro-, ethyl ester,3-chloro-benzoic acid ethyl ester,pubchem3704,acmc-1bt4u,ethyl3-chlorobenzoate,ksc495m6f,rarechem al bi 0056 |
| IUPAC Name | ethyl 3-chlorobenzoate |
| InChI Key | LVFRSNCBCHABAM-UHFFFAOYSA-N |
| Molecular Formula | C9H9ClO2 |
Methyl 4-fluoro-2-methylbenzoate, 98%
CAS: 174403-69-1 Molecular Formula: C9H9FO2 Molecular Weight (g/mol): 168.17 MDL Number: MFCD06203790 InChI Key: ZQFCTCYDRQFPBU-UHFFFAOYSA-N Synonym: benzoic acid, 4-fluoro-2-methyl-, methyl ester,4-fluoro-2-methylbenzoic acid methyl ester,rarechem al bf 0506,methyl=4-fluoro-2-methylbenzoate,4-fluoro-2-methyl benzoic acid methyl ester,4-fluoro-2-methyl-benzoic acid methyl ester,benzoic acid,4-fluoro-2-methyl-,methyl ester PubChem CID: 2782181 IUPAC Name: methyl 4-fluoro-2-methylbenzoate SMILES: COC(=O)C1=C(C)C=C(F)C=C1
| PubChem CID | 2782181 |
|---|---|
| CAS | 174403-69-1 |
| Molecular Weight (g/mol) | 168.17 |
| MDL Number | MFCD06203790 |
| SMILES | COC(=O)C1=C(C)C=C(F)C=C1 |
| Synonym | benzoic acid, 4-fluoro-2-methyl-, methyl ester,4-fluoro-2-methylbenzoic acid methyl ester,rarechem al bf 0506,methyl=4-fluoro-2-methylbenzoate,4-fluoro-2-methyl benzoic acid methyl ester,4-fluoro-2-methyl-benzoic acid methyl ester,benzoic acid,4-fluoro-2-methyl-,methyl ester |
| IUPAC Name | methyl 4-fluoro-2-methylbenzoate |
| InChI Key | ZQFCTCYDRQFPBU-UHFFFAOYSA-N |
| Molecular Formula | C9H9FO2 |
Methyl 2-methoxy-5-nitrobenzoate, 98%
CAS: 34841-11-7 Molecular Formula: C9H9NO5 Molecular Weight (g/mol): 211.173 MDL Number: MFCD00673023 InChI Key: DOBFJVVTBNTGCW-UHFFFAOYSA-N Synonym: 2-methoxy-5-nitrobenzoic acid methyl ester,methyl2-methoxy-5-nitrobenzoate,methyl-2-methoxy-5-nitrobenzoate,5-nitro-o-anisic acid methyl ester,pubchem14052,acmc-1adrt,methyl 5-nitro-o-anisate,asischem d13383,rarechem al bf 0877,timtec-bb sbb014757 PubChem CID: 7020925 IUPAC Name: methyl 2-methoxy-5-nitrobenzoate SMILES: COC1=C(C=C(C=C1)[N+](=O)[O-])C(=O)OC
| PubChem CID | 7020925 |
|---|---|
| CAS | 34841-11-7 |
| Molecular Weight (g/mol) | 211.173 |
| MDL Number | MFCD00673023 |
| SMILES | COC1=C(C=C(C=C1)[N+](=O)[O-])C(=O)OC |
| Synonym | 2-methoxy-5-nitrobenzoic acid methyl ester,methyl2-methoxy-5-nitrobenzoate,methyl-2-methoxy-5-nitrobenzoate,5-nitro-o-anisic acid methyl ester,pubchem14052,acmc-1adrt,methyl 5-nitro-o-anisate,asischem d13383,rarechem al bf 0877,timtec-bb sbb014757 |
| IUPAC Name | methyl 2-methoxy-5-nitrobenzoate |
| InChI Key | DOBFJVVTBNTGCW-UHFFFAOYSA-N |
| Molecular Formula | C9H9NO5 |
Methyl 3,5-dimethoxybenzoate, 98%
CAS: 2150-37-0 Molecular Formula: C10H12O4 Molecular Weight (g/mol): 196.20 MDL Number: MFCD00008432 InChI Key: YXUIOVUOFQKWDM-UHFFFAOYSA-N Synonym: 3,5-dimethoxybenzoic acid methyl ester,benzoic acid, 3,5-dimethoxy-, methyl ester,3,5-dimethoxybenzoic acid methyl,methyl 3,5-bis methyloxy benzoate,acmc-1ccvs,rarechem al bf 0065,methyl 3,5-dimethoxybnezoate,ksc489q8p,ethyl 3,5-dimethoxybenzoate,methyl 3,5-dimethoxybenzoate PubChem CID: 75074 IUPAC Name: methyl 3,5-dimethoxybenzoate SMILES: COC(=O)C1=CC(OC)=CC(OC)=C1
| PubChem CID | 75074 |
|---|---|
| CAS | 2150-37-0 |
| Molecular Weight (g/mol) | 196.20 |
| MDL Number | MFCD00008432 |
| SMILES | COC(=O)C1=CC(OC)=CC(OC)=C1 |
| Synonym | 3,5-dimethoxybenzoic acid methyl ester,benzoic acid, 3,5-dimethoxy-, methyl ester,3,5-dimethoxybenzoic acid methyl,methyl 3,5-bis methyloxy benzoate,acmc-1ccvs,rarechem al bf 0065,methyl 3,5-dimethoxybnezoate,ksc489q8p,ethyl 3,5-dimethoxybenzoate,methyl 3,5-dimethoxybenzoate |
| IUPAC Name | methyl 3,5-dimethoxybenzoate |
| InChI Key | YXUIOVUOFQKWDM-UHFFFAOYSA-N |
| Molecular Formula | C10H12O4 |
Methyl 4-fluoro-2-methoxybenzoate, 97+%, Thermo Scientific Chemicals
CAS: 204707-42-6 Molecular Formula: C9H9FO3 Molecular Weight (g/mol): 184.17 MDL Number: MFCD06203990 InChI Key: LJUAEPNTXDJBRX-UHFFFAOYSA-N Synonym: 4-fluoro-2-methoxybenzoic acid methyl ester,methyl 2-methoxy-4-fluoro-benzoate,benzoic acid, 4-fluoro-2-methoxy-, methyl ester,rarechem al bf 1023,methyl-4-fluoro-2-methoxybenzoate,methyl 4-fluoranyl-2-methoxy-benzoate,2-methoxy-4-fluorobenzoic acid methyl ester,4-fluoro-2-methoxy-benzoic acid methyl ester PubChem CID: 10241478 IUPAC Name: methyl 4-fluoro-2-methoxybenzoate SMILES: COC(=O)C1=C(OC)C=C(F)C=C1
| PubChem CID | 10241478 |
|---|---|
| CAS | 204707-42-6 |
| Molecular Weight (g/mol) | 184.17 |
| MDL Number | MFCD06203990 |
| SMILES | COC(=O)C1=C(OC)C=C(F)C=C1 |
| Synonym | 4-fluoro-2-methoxybenzoic acid methyl ester,methyl 2-methoxy-4-fluoro-benzoate,benzoic acid, 4-fluoro-2-methoxy-, methyl ester,rarechem al bf 1023,methyl-4-fluoro-2-methoxybenzoate,methyl 4-fluoranyl-2-methoxy-benzoate,2-methoxy-4-fluorobenzoic acid methyl ester,4-fluoro-2-methoxy-benzoic acid methyl ester |
| IUPAC Name | methyl 4-fluoro-2-methoxybenzoate |
| InChI Key | LJUAEPNTXDJBRX-UHFFFAOYSA-N |
| Molecular Formula | C9H9FO3 |
Methyl 2,5-dichlorobenzoate, 99%
CAS: 2905-69-3 Molecular Formula: C8H6Cl2O2 Molecular Weight (g/mol): 205.03 MDL Number: MFCD00000606 InChI Key: SPJQBGGHUDNAIC-UHFFFAOYSA-N Synonym: 2,5-dichlorobenzoic acid methyl ester,benzoic acid, 2,5-dichloro-, methyl ester,methyl-2,5-dichlorobenzoate,unii-j07555o4he,benzoic acid, dichloro-, methyl ester,pubchem3714,acmc-1bhkt,2,5-dcbme,rarechem al bf 0427,methyl 2,5-bis chloranyl benzoate PubChem CID: 17947 IUPAC Name: methyl 2,5-dichlorobenzoate SMILES: COC(=O)C1=CC(Cl)=CC=C1Cl
| PubChem CID | 17947 |
|---|---|
| CAS | 2905-69-3 |
| Molecular Weight (g/mol) | 205.03 |
| MDL Number | MFCD00000606 |
| SMILES | COC(=O)C1=CC(Cl)=CC=C1Cl |
| Synonym | 2,5-dichlorobenzoic acid methyl ester,benzoic acid, 2,5-dichloro-, methyl ester,methyl-2,5-dichlorobenzoate,unii-j07555o4he,benzoic acid, dichloro-, methyl ester,pubchem3714,acmc-1bhkt,2,5-dcbme,rarechem al bf 0427,methyl 2,5-bis chloranyl benzoate |
| IUPAC Name | methyl 2,5-dichlorobenzoate |
| InChI Key | SPJQBGGHUDNAIC-UHFFFAOYSA-N |
| Molecular Formula | C8H6Cl2O2 |
Methyl 2,5-dihydroxybenzoate, 98%
CAS: 2150-46-1 Molecular Formula: C8H8O4 Molecular Weight (g/mol): 168.15 MDL Number: MFCD00016464 InChI Key: XGDPKUKRQHHZTH-UHFFFAOYSA-N Synonym: methyl gentisate,gentisic acid methyl ester,methyl2,5-dihydroxybenzoate,benzoic acid, 2,5-dihydroxy-, methyl ester,methyl dihydroxybenzoate,2,5-dihydroxybenzoic acid methyl ester,gentisic acid, methyl ester,methyl-2,5-dihydroxybenzoate,unii-ls28b004km,rarechem al bf 0043 PubChem CID: 75077 IUPAC Name: methyl 2,5-dihydroxybenzoate SMILES: COC(=O)C1=CC(O)=CC=C1O
| PubChem CID | 75077 |
|---|---|
| CAS | 2150-46-1 |
| Molecular Weight (g/mol) | 168.15 |
| MDL Number | MFCD00016464 |
| SMILES | COC(=O)C1=CC(O)=CC=C1O |
| Synonym | methyl gentisate,gentisic acid methyl ester,methyl2,5-dihydroxybenzoate,benzoic acid, 2,5-dihydroxy-, methyl ester,methyl dihydroxybenzoate,2,5-dihydroxybenzoic acid methyl ester,gentisic acid, methyl ester,methyl-2,5-dihydroxybenzoate,unii-ls28b004km,rarechem al bf 0043 |
| IUPAC Name | methyl 2,5-dihydroxybenzoate |
| InChI Key | XGDPKUKRQHHZTH-UHFFFAOYSA-N |
| Molecular Formula | C8H8O4 |
Ethyl 4-chlorobenzoate, 98+%
CAS: 7335-27-5 Molecular Formula: C9H9ClO2 Molecular Weight (g/mol): 184.62 MDL Number: MFCD00013645 InChI Key: RWBYCMPOFNRISR-UHFFFAOYSA-N Synonym: ethyl p-chlorobenzoate,benzoic acid, 4-chloro-, ethyl ester,ethyl-4-chlorobenzoate,p-ethoxycarbonyl phenyl chloride,ethyl4-chlorobenzoate,rarechem al bi 0077,4-chlorobenzoic acid ethyl ester,ethyl p-chlorobenzate,benzoic acid, p-chloro-, ethyl ester,pubchem3705 PubChem CID: 81785 IUPAC Name: ethyl 4-chlorobenzoate SMILES: CCOC(=O)C1=CC=C(Cl)C=C1
| PubChem CID | 81785 |
|---|---|
| CAS | 7335-27-5 |
| Molecular Weight (g/mol) | 184.62 |
| MDL Number | MFCD00013645 |
| SMILES | CCOC(=O)C1=CC=C(Cl)C=C1 |
| Synonym | ethyl p-chlorobenzoate,benzoic acid, 4-chloro-, ethyl ester,ethyl-4-chlorobenzoate,p-ethoxycarbonyl phenyl chloride,ethyl4-chlorobenzoate,rarechem al bi 0077,4-chlorobenzoic acid ethyl ester,ethyl p-chlorobenzate,benzoic acid, p-chloro-, ethyl ester,pubchem3705 |
| IUPAC Name | ethyl 4-chlorobenzoate |
| InChI Key | RWBYCMPOFNRISR-UHFFFAOYSA-N |
| Molecular Formula | C9H9ClO2 |
2,4,6-Trifluorobenzoic acid, 98%
CAS: 28314-80-9 Molecular Formula: C7H3F3O2 Molecular Weight (g/mol): 176.094 MDL Number: MFCD00042398 InChI Key: SJZATRRXUILGHH-UHFFFAOYSA-N Synonym: benzoic acid, 2,4,6-trifluoro,2,4,6-trifluorobenzoicacid,the derivatives,2,4,6-trifluorobenzioc acid,pubchem1347,acmc-209h1r,ksc204g9t,2,4,6-trifluoro-benzoic acid,rarechem al bo 0448,benzoicacid, 2,4,6-trifluoro PubChem CID: 520373 IUPAC Name: 2,4,6-trifluorobenzoic acid SMILES: C1=C(C=C(C(=C1F)C(=O)O)F)F
| PubChem CID | 520373 |
|---|---|
| CAS | 28314-80-9 |
| Molecular Weight (g/mol) | 176.094 |
| MDL Number | MFCD00042398 |
| SMILES | C1=C(C=C(C(=C1F)C(=O)O)F)F |
| Synonym | benzoic acid, 2,4,6-trifluoro,2,4,6-trifluorobenzoicacid,the derivatives,2,4,6-trifluorobenzioc acid,pubchem1347,acmc-209h1r,ksc204g9t,2,4,6-trifluoro-benzoic acid,rarechem al bo 0448,benzoicacid, 2,4,6-trifluoro |
| IUPAC Name | 2,4,6-trifluorobenzoic acid |
| InChI Key | SJZATRRXUILGHH-UHFFFAOYSA-N |
| Molecular Formula | C7H3F3O2 |
Ethyl 2-iodobenzoate, 98%
CAS: 1829-28-3 Molecular Formula: C9H9IO2 Molecular Weight (g/mol): 276.07 MDL Number: MFCD00051796 InChI Key: QOUFDDUDXYJWHV-UHFFFAOYSA-N Synonym: 2-iodobenzoic acid ethyl ester,rarechem al bi 0562,ethyl iodobenzoate,ethyl-2-iodobenzoate,ethyl 2-iodanylbenzoate,acmc-1ag98,2-ethoxycarbonyl iodobenzene,benzoic acid, 2-iodo-,ethyl ester,benzoic acid, 2-iodo-, ethyl ester PubChem CID: 2829347 IUPAC Name: ethyl 2-iodobenzoate SMILES: CCOC(=O)C1=CC=CC=C1I
| PubChem CID | 2829347 |
|---|---|
| CAS | 1829-28-3 |
| Molecular Weight (g/mol) | 276.07 |
| MDL Number | MFCD00051796 |
| SMILES | CCOC(=O)C1=CC=CC=C1I |
| Synonym | 2-iodobenzoic acid ethyl ester,rarechem al bi 0562,ethyl iodobenzoate,ethyl-2-iodobenzoate,ethyl 2-iodanylbenzoate,acmc-1ag98,2-ethoxycarbonyl iodobenzene,benzoic acid, 2-iodo-,ethyl ester,benzoic acid, 2-iodo-, ethyl ester |
| IUPAC Name | ethyl 2-iodobenzoate |
| InChI Key | QOUFDDUDXYJWHV-UHFFFAOYSA-N |
| Molecular Formula | C9H9IO2 |
2,3-Difluorophenylacetic acid, 98%
CAS: 145689-41-4 Molecular Formula: C8H6F2O2 Molecular Weight (g/mol): 172.131 MDL Number: MFCD00040968 InChI Key: UXSQXUSJGPVOKT-UHFFFAOYSA-N Synonym: 2,3-difluorophenylacetic acid,2-2,3-difluorophenyl acetic acid,2,3-difluorophenyl acetic acid,2,3-difluorophenylaceticacid,benzeneacetic acid, 2,3-difluoro,2,3-difluorobenzeneacetic acid,rarechem al bo 0630,pubchem1916,acmc-1crot PubChem CID: 520772 IUPAC Name: 2-(2,3-difluorophenyl)acetic acid SMILES: C1=CC(=C(C(=C1)F)F)CC(=O)O
| PubChem CID | 520772 |
|---|---|
| CAS | 145689-41-4 |
| Molecular Weight (g/mol) | 172.131 |
| MDL Number | MFCD00040968 |
| SMILES | C1=CC(=C(C(=C1)F)F)CC(=O)O |
| Synonym | 2,3-difluorophenylacetic acid,2-2,3-difluorophenyl acetic acid,2,3-difluorophenyl acetic acid,2,3-difluorophenylaceticacid,benzeneacetic acid, 2,3-difluoro,2,3-difluorobenzeneacetic acid,rarechem al bo 0630,pubchem1916,acmc-1crot |
| IUPAC Name | 2-(2,3-difluorophenyl)acetic acid |
| InChI Key | UXSQXUSJGPVOKT-UHFFFAOYSA-N |
| Molecular Formula | C8H6F2O2 |