Filtered Search Results
Glycerol, 99+%, Extra Pure
CAS: 56-81-5 Molecular Formula: C3H8O3 Molecular Weight (g/mol): 92.09 MDL Number: MFCD00004722 InChI Key: PEDCQBHIVMGVHV-UHFFFAOYSA-N Synonym: glycerol,glycerin,glycerine,1,2,3-propanetriol,glycyl alcohol,trihydroxypropane,glyceritol,propanetriol,1,2,3-trihydroxypropane,osmoglyn PubChem CID: 753 ChEBI: CHEBI:17754 IUPAC Name: propane-1,2,3-triol SMILES: OCC(O)CO
| PubChem CID | 753 |
|---|---|
| CAS | 56-81-5 |
| Molecular Weight (g/mol) | 92.09 |
| ChEBI | CHEBI:17754 |
| MDL Number | MFCD00004722 |
| SMILES | OCC(O)CO |
| Synonym | glycerol,glycerin,glycerine,1,2,3-propanetriol,glycyl alcohol,trihydroxypropane,glyceritol,propanetriol,1,2,3-trihydroxypropane,osmoglyn |
| IUPAC Name | propane-1,2,3-triol |
| InChI Key | PEDCQBHIVMGVHV-UHFFFAOYSA-N |
| Molecular Formula | C3H8O3 |
Tetrabutylammonium bromide, 99+%
CAS: 1643-19-2 Molecular Formula: C16H36BrN Molecular Weight (g/mol): 322.36 MDL Number: MFCD00011633 InChI Key: JRMUNVKIHCOMHV-UHFFFAOYSA-M Synonym: tetrabutylammonium bromide,tetra-n-butylammonium bromide,tbab,tetrabutylazanium bromide,tetrabutyl ammonium bromide,tetrabutyl-ammonium bromide,aliquat 100,tbabr,ipc-tba-br,unii-vjz168i98r PubChem CID: 74236 ChEBI: CHEBI:51993 IUPAC Name: tetrabutylazanium;bromide SMILES: CCCC[N+](CCCC)(CCCC)CCCC.[Br-]
| PubChem CID | 74236 |
|---|---|
| CAS | 1643-19-2 |
| Molecular Weight (g/mol) | 322.36 |
| ChEBI | CHEBI:51993 |
| MDL Number | MFCD00011633 |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.[Br-] |
| Synonym | tetrabutylammonium bromide,tetra-n-butylammonium bromide,tbab,tetrabutylazanium bromide,tetrabutyl ammonium bromide,tetrabutyl-ammonium bromide,aliquat 100,tbabr,ipc-tba-br,unii-vjz168i98r |
| IUPAC Name | tetrabutylazanium;bromide |
| InChI Key | JRMUNVKIHCOMHV-UHFFFAOYSA-M |
| Molecular Formula | C16H36BrN |
Invitrogen™ BODIPY™ 500/510 C1, C12 (4,4-Difluoro-5-Methyl-4-Bora-3a,4a-Diaza-s-Indacene-3-Dodecanoic Acid)
Forms excimers and exhibits red-shifted fluorescence emission when incorporated into living cells
Thermo Fisher Scientific DDM/CHS Solution (10:1)
A ready-to-use solution for solubilization of membrane proteins while maintaining structural integrity and activity.
Invitrogen™ BODIPY™ FL C12 (4,4-Difluoro-5,7-Dimethyl-4-Bora-3a,4a-Diaza-s-Indacene-3-Dodecanoic Acid)
The green fluorescent fatty acid, BODIPY™ FL C12 can be used as a synthetic precursor to a wide variety of fluorescent phospholipids.
Dichloromethane, 99.8%, Extra Dry over Molecular Sieve, Stabilized, AcroSeal™
CAS: 75-09-2 Molecular Formula: CH2Cl2 Molecular Weight (g/mol): 84.93 MDL Number: MFCD00000881 InChI Key: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonym: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm PubChem CID: 6344 ChEBI: CHEBI:15767 IUPAC Name: dichloromethane SMILES: ClCCl
| PubChem CID | 6344 |
|---|---|
| CAS | 75-09-2 |
| Molecular Weight (g/mol) | 84.93 |
| ChEBI | CHEBI:15767 |
| MDL Number | MFCD00000881 |
| SMILES | ClCCl |
| Synonym | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| IUPAC Name | dichloromethane |
| InChI Key | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| Molecular Formula | CH2Cl2 |
N,N-Dimethylacetamide, 99.5%, Extra Dry over Molecular Sieve, AcroSeal™
CAS: 127-19-5 Molecular Formula: C4H9NO Molecular Weight (g/mol): 87.12 MDL Number: MFCD00008686 InChI Key: FXHOOIRPVKKKFG-UHFFFAOYSA-N Synonym: dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine PubChem CID: 31374 ChEBI: CHEBI:84254 IUPAC Name: N,N-dimethylacetamide SMILES: CN(C)C(C)=O
| PubChem CID | 31374 |
|---|---|
| CAS | 127-19-5 |
| Molecular Weight (g/mol) | 87.12 |
| ChEBI | CHEBI:84254 |
| MDL Number | MFCD00008686 |
| SMILES | CN(C)C(C)=O |
| Synonym | dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine |
| IUPAC Name | N,N-dimethylacetamide |
| InChI Key | FXHOOIRPVKKKFG-UHFFFAOYSA-N |
| Molecular Formula | C4H9NO |
n-Hexadecane, 99%, pure
CAS: 544-76-3 Molecular Formula: C16H34 Molecular Weight (g/mol): 226.44 MDL Number: MFCD00008998 InChI Key: DCAYPVUWAIABOU-UHFFFAOYSA-N Synonym: n-hexadecane,cetane,n-cetane,hexadecan,hexadekan,cetan,zetan,unii-f8z00shp6q,ccris 5833,pentadecane, methyl PubChem CID: 11006 ChEBI: CHEBI:45296 IUPAC Name: hexadecane SMILES: CCCCCCCCCCCCCCCC
| PubChem CID | 11006 |
|---|---|
| CAS | 544-76-3 |
| Molecular Weight (g/mol) | 226.44 |
| ChEBI | CHEBI:45296 |
| MDL Number | MFCD00008998 |
| SMILES | CCCCCCCCCCCCCCCC |
| Synonym | n-hexadecane,cetane,n-cetane,hexadecan,hexadekan,cetan,zetan,unii-f8z00shp6q,ccris 5833,pentadecane, methyl |
| IUPAC Name | hexadecane |
| InChI Key | DCAYPVUWAIABOU-UHFFFAOYSA-N |
| Molecular Formula | C16H34 |
(Trimethylsilyl)diazomethane, 1.8 to 2.4M solution in hexanes
CAS: 18107-18-1 Molecular Formula: C4H10N2Si Molecular Weight (g/mol): 114.22 InChI Key: ONDSBJMLAHVLMI-UHFFFAOYSA-N Synonym: trimethylsilyl diazomethane,trimethylsilyldiazomethane,diazomethyl trimethylsilane,tms-diazomethane,diazomethyl trimethyl silane,tmschn2,silane, diazomethyl trimethyl,unii-qi98hqo8c4,diazomethyl-trimethyl-silane,qi98hqo8c4 PubChem CID: 167693 IUPAC Name: diazomethyl(trimethyl)silane SMILES: C[Si](C)(C)C=[N+]=[N-]
| PubChem CID | 167693 |
|---|---|
| CAS | 18107-18-1 |
| Molecular Weight (g/mol) | 114.22 |
| SMILES | C[Si](C)(C)C=[N+]=[N-] |
| Synonym | trimethylsilyl diazomethane,trimethylsilyldiazomethane,diazomethyl trimethylsilane,tms-diazomethane,diazomethyl trimethyl silane,tmschn2,silane, diazomethyl trimethyl,unii-qi98hqo8c4,diazomethyl-trimethyl-silane,qi98hqo8c4 |
| IUPAC Name | diazomethyl(trimethyl)silane |
| InChI Key | ONDSBJMLAHVLMI-UHFFFAOYSA-N |
| Molecular Formula | C4H10N2Si |
Hydriodic acid, for analysis, 57 wt.% aqueous solution, distilled, stabilized
CAS: 10034-85-2 Molecular Formula: HI Molecular Weight (g/mol): 127.91 MDL Number: MFCD00011347 InChI Key: XMBWDFGMSWQBCA-UHFFFAOYSA-N IUPAC Name: hydrogen iodide SMILES: I
| CAS | 10034-85-2 |
|---|---|
| Molecular Weight (g/mol) | 127.91 |
| MDL Number | MFCD00011347 |
| SMILES | I |
| IUPAC Name | hydrogen iodide |
| InChI Key | XMBWDFGMSWQBCA-UHFFFAOYSA-N |
| Molecular Formula | HI |
Tetrabutylammonium hydroxide, 40 wt.% (1.5M) solution in water
CAS: 2052-49-5 | C16H37NO | 259.48 g/mol
| Linear Formula | [CH3(CH2)3]4NOH |
|---|---|
| Molecular Weight (g/mol) | 259.48 |
| InChI Key | VDZOOKBUILJEDG-UHFFFAOYSA-M |
| Density | 0.9950g/mL |
| PubChem CID | 2723671 |
| Name Note | 40 wt.% Solution in Water |
| Percent Purity | 38 to 42% (Total base) |
| Fieser | 05,645; 11,500 |
| Formula Weight | 259.46 |
| Boiling Point | >100.0°C |
| Color | White to Yellow |
| Physical Form | Crystals or Powder |
| Chemical Name or Material | Tetrabutylammonium hydroxide |
| SMILES | [OH-].CCCC[N+](CCCC)(CCCC)CCCC |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: Rinse mouth. Do NOT induce vomiting. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with wat |
| MDL Number | MFCD00009425 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. Harmful if swallowed. |
| Solubility Information | Solubility in water: soluble. |
| Packaging | Plastic bottle |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | tetrabutylammonium hydroxide,tetra-n-butylammonium hydroxide,tetrabutylazanium hydroxide,tetrabutylammoniumhydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide,ammonium, tetrabutyl-, hydroxide,n,n,n-tributyl-1-butanaminium hydroxide,tetra n-butyl ammonium hydroxide,tetra-n-butyl ammonium hydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide 1:1 |
| IUPAC Name | tetrabutylazanium;hydroxide |
| Beilstein | 04, II, 634 |
| Molecular Formula | C16H37NO |
| EINECS Number | 218-147-6 |
| Specific Gravity | 0.995 |
Dimethyl carbonate, 99+%, Extra Dry, AcroSeal™
CAS: 616-38-6 Molecular Formula: C3H6O3 Molecular Weight (g/mol): 90.08 MDL Number: MFCD00008420 InChI Key: IEJIGPNLZYLLBP-UHFFFAOYSA-N Synonym: methyl carbonate,carbonic acid, dimethyl ester,carbonic acid dimethyl ester,methyl carbonate meo 2co,unii-ke9j097spn,dimethylcarbonate,ch3ocooch3,ke9j097spn,dimethyl ester of carbonic acid,dsstox_cid_9192 PubChem CID: 12021 ChEBI: CHEBI:36596 IUPAC Name: dimethyl carbonate SMILES: COC(=O)OC
| PubChem CID | 12021 |
|---|---|
| CAS | 616-38-6 |
| Molecular Weight (g/mol) | 90.08 |
| ChEBI | CHEBI:36596 |
| MDL Number | MFCD00008420 |
| SMILES | COC(=O)OC |
| Synonym | methyl carbonate,carbonic acid, dimethyl ester,carbonic acid dimethyl ester,methyl carbonate meo 2co,unii-ke9j097spn,dimethylcarbonate,ch3ocooch3,ke9j097spn,dimethyl ester of carbonic acid,dsstox_cid_9192 |
| IUPAC Name | dimethyl carbonate |
| InChI Key | IEJIGPNLZYLLBP-UHFFFAOYSA-N |
| Molecular Formula | C3H6O3 |
Sodium tetraethylborate, 97%, pure, Thermo Scientific Chemicals
CAS: 15523-24-7 Molecular Formula: C8H20BNa Molecular Weight (g/mol): 150.04 MDL Number: MFCD00061547 InChI Key: SZSBMTRYJRHYNI-UHFFFAOYSA-N Synonym: sodium tetraethylborate,sodium tetraethylboranuide,borate 1-,tetraethyl-, sodium 1:1,sodium tetraethylborate 1-,et4bna,sodiotetraethylboron v,borate 1-, tetraethyl-, sodium,sodium tetraethylborate 1g PubChem CID: 23681030 IUPAC Name: sodium;tetraethylboranuide SMILES: [B-](CC)(CC)(CC)CC.[Na+]
| PubChem CID | 23681030 |
|---|---|
| CAS | 15523-24-7 |
| Molecular Weight (g/mol) | 150.04 |
| MDL Number | MFCD00061547 |
| SMILES | [B-](CC)(CC)(CC)CC.[Na+] |
| Synonym | sodium tetraethylborate,sodium tetraethylboranuide,borate 1-,tetraethyl-, sodium 1:1,sodium tetraethylborate 1-,et4bna,sodiotetraethylboron v,borate 1-, tetraethyl-, sodium,sodium tetraethylborate 1g |
| IUPAC Name | sodium;tetraethylboranuide |
| InChI Key | SZSBMTRYJRHYNI-UHFFFAOYSA-N |
| Molecular Formula | C8H20BNa |
| Molecular Weight (g/mol) | 122.02 |
|---|---|
| CAS Min % | 92.49 |
| Chemical Name or Material | 9-Borabicyclo[3.3.1]nonane |
| SMILES | [B]1C2CCCC1CCC2 |
| InChI Key | AMKGKYQBASDDJB-UHFFFAOYSA-N |
| Density | 0.8840g/mL |
| PubChem CID | 6327450 |
| Fieser | 02,31; 03,24; 04,41; 05,46; 06,62; 07,29; 08,47; 09,57; 10,48; 11,68; 13,92; 14,52; 15,43; 17,49; 01,732; 04,356 |
| CAS | 109-99-9 |
| Health Hazard 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Handle under inert gas. Protect from moisture |
| MDL Number | MFCD00074742 |
| Health Hazard 2 | GHS H Statement In contact with water releases flammable gases. Highly flammable liquid and vapor. Causes severe skin burns and eye damage. May cause respiratory irritation. Suspected of causing cancer. May form explo |
| Solubility Information | Solubility in water: reacts |
| Flash Point | −17°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | 9-borabicyclo 3.3.1 nonane,9-borabicyclo 3.3.1 nonan,9-borabicyclo 3,3,1 nonane,9$l^ 2-borabicyclo 3.3.1 nonane,1s,5s-9-borabicyclo 3.3.1 nonane,monomer; 21205-91-4 dimer,9-borabicyclo 3.3.1 nonane,9-bbn,intetrahydrofuran |
| IUPAC Name | 9$l^{2}-borabicyclo[3.3.1]nonane |
| Molecular Formula | C8H15B |
| EINECS Number | 206-000-9 |
| Formula Weight | 122.02 |
| Specific Gravity | 0.884 |
| CAS Max % | 93.86 |