CAS RN 103404-75-7
CAS RN 103404-75-7
D-Luciferin sodium salt monohydrate, 98+%
CAS: 103404-75-7 Molecular Formula: C11H7N2NaO3S2 Molecular Weight (g/mol): 302.298 MDL Number: MFCD11865368 InChI Key: BZNVUYVALNTPBG-QWLWRJJTSA-M Synonym: Firefly Luciferin monosodium salt monohydrate PubChem CID: 133109097 IUPAC Name: sodium;(2E,4R)-2-(6-oxo-1,3-benzothiazol-2-ylidene)-1,3-thiazolidine-4-carboxylate SMILES: C1C(NC(=C2N=C3C=CC(=O)C=C3S2)S1)C(=O)[O-].[Na+]
MedChemExpress D-Luciferin sodium
MedChemExpress D-Luciferin (D-(-)-Luciferin) sodium is the substrate of luciferases that catalyze the production of light in bioluminescent insects.
MedChemExpress D-Luciferin sodium
MedChemExpress D-Luciferin (D-(-)-Luciferin) sodium is the substrate of luciferases that catalyze the production of light in bioluminescent insects.