Organic acids and derivatives
Filtered Search Results
Benzyl bromoacetate, 97%
CAS: 5437-45-6 Molecular Formula: C9H9BrO2 Molecular Weight (g/mol): 229.073 MDL Number: MFCD00000190 InChI Key: JHVLLYQQQYIWKX-UHFFFAOYSA-N Synonym: benzyl bromoacetate,bromoacetic acid benzyl ester,acetic acid, bromo-, phenylmethyl ester,merbac 35,caswell no. 082a,acetic acid, bromo-, benzyl ester,unii-64u2rk18d3,phenylmethyl 2-bromoacetate,epa pesticide chemical code 008710,benzyl bromacetate PubChem CID: 62576 IUPAC Name: benzyl 2-bromoacetate SMILES: C1=CC=C(C=C1)COC(=O)CBr
| PubChem CID | 62576 |
|---|---|
| CAS | 5437-45-6 |
| Molecular Weight (g/mol) | 229.073 |
| MDL Number | MFCD00000190 |
| SMILES | C1=CC=C(C=C1)COC(=O)CBr |
| Synonym | benzyl bromoacetate,bromoacetic acid benzyl ester,acetic acid, bromo-, phenylmethyl ester,merbac 35,caswell no. 082a,acetic acid, bromo-, benzyl ester,unii-64u2rk18d3,phenylmethyl 2-bromoacetate,epa pesticide chemical code 008710,benzyl bromacetate |
| IUPAC Name | benzyl 2-bromoacetate |
| InChI Key | JHVLLYQQQYIWKX-UHFFFAOYSA-N |
| Molecular Formula | C9H9BrO2 |
N,N-Dimethylacetamide, 99%
CAS: 127-19-5 Molecular Formula: C4H9NO Molecular Weight (g/mol): 87.12 MDL Number: MFCD00008686 InChI Key: FXHOOIRPVKKKFG-UHFFFAOYSA-N Synonym: dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine PubChem CID: 31374 ChEBI: CHEBI:84254 IUPAC Name: N,N-dimethylacetamide SMILES: CN(C)C(C)=O
| PubChem CID | 31374 |
|---|---|
| CAS | 127-19-5 |
| Molecular Weight (g/mol) | 87.12 |
| ChEBI | CHEBI:84254 |
| MDL Number | MFCD00008686 |
| SMILES | CN(C)C(C)=O |
| Synonym | dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine |
| IUPAC Name | N,N-dimethylacetamide |
| InChI Key | FXHOOIRPVKKKFG-UHFFFAOYSA-N |
| Molecular Formula | C4H9NO |
trans-1,2-Diaminocyclohexane-N,N,N',N'-tetraacetic Acid Monohydrate, 98%
CAS: 125572-95-4 Molecular Formula: C14H20N2O8 Molecular Weight (g/mol): 344.32 MDL Number: MFCD00149243,MFCD00066429,MFCD00003845 InChI Key: FCKYPQBAHLOOJQ-NXEZZACHSA-L Synonym: 2,2',2,2'-trans-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,dcyta,trans-1,2-diaminocyclohexane-n,n,n',n'-tetraacetic acid monohydrate,1,2-cyclohexanedinitrilotetraacetic acid,2,2',2,2'-1r,2r-rel-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,trans-1,2-cyclohexanediaminetetraacetic acid monohydrate,cdta monohydrate,ctda monohydrate,chel-cd,chel r-cd PubChem CID: 2723844 SMILES: [O-]C(=O)C[NH+](CC([O-])=O)[C@@H]1CCCC[C@H]1[NH+](CC([O-])=O)CC([O-])=O
| PubChem CID | 2723844 |
|---|---|
| CAS | 125572-95-4 |
| Molecular Weight (g/mol) | 344.32 |
| MDL Number | MFCD00149243,MFCD00066429,MFCD00003845 |
| SMILES | [O-]C(=O)C[NH+](CC([O-])=O)[C@@H]1CCCC[C@H]1[NH+](CC([O-])=O)CC([O-])=O |
| Synonym | 2,2',2,2'-trans-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,dcyta,trans-1,2-diaminocyclohexane-n,n,n',n'-tetraacetic acid monohydrate,1,2-cyclohexanedinitrilotetraacetic acid,2,2',2,2'-1r,2r-rel-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,trans-1,2-cyclohexanediaminetetraacetic acid monohydrate,cdta monohydrate,ctda monohydrate,chel-cd,chel r-cd |
| InChI Key | FCKYPQBAHLOOJQ-NXEZZACHSA-L |
| Molecular Formula | C14H20N2O8 |
O-(1H-Benzotriazol-1-yl)-N,N,N',N'-tetramethyluronium hexafluorophosphate, 98%
CAS: 94790-37-1 Molecular Formula: C11H16F6N5OP Molecular Weight (g/mol): 379.247 MDL Number: MFCD00075445 InChI Key: UQYZFNUUOSSNKT-UHFFFAOYSA-N Synonym: hbtu,o-benzotriazol-1-yl-n,n,n',n'-tetramethyluronium hexafluorophosphate,2-1h-benzotriazole-1-yl-1,1,3,3-tetramethyluronium hexafluorophosphate,hbtu-reagent,o-benzotriazol-1-yl-tetramethyluronium hexafluorophosphate,hbtu o-benzotriazole-n,n,n',n'-tetramethyl-uronium-hexafluoro-phosphate,n,n,n',n'-tetramethyl-o-1h-benzotriazol-1-yl uronium hexafluorophosphate,o-1h-benzotriazol-1-yl-n,n,n',n'-tetramethyluronium hexafluorophosphate,o-benzotriazole-n,n,n',n'-tetramethyluronium hexafluorophosphate PubChem CID: 2733084 IUPAC Name: [benzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium;hexafluorophosphate SMILES: CN(C)C(=[N+](C)C)ON1C2=CC=CC=C2N=N1.F[P-](F)(F)(F)(F)F
| PubChem CID | 2733084 |
|---|---|
| CAS | 94790-37-1 |
| Molecular Weight (g/mol) | 379.247 |
| MDL Number | MFCD00075445 |
| SMILES | CN(C)C(=[N+](C)C)ON1C2=CC=CC=C2N=N1.F[P-](F)(F)(F)(F)F |
| Synonym | hbtu,o-benzotriazol-1-yl-n,n,n',n'-tetramethyluronium hexafluorophosphate,2-1h-benzotriazole-1-yl-1,1,3,3-tetramethyluronium hexafluorophosphate,hbtu-reagent,o-benzotriazol-1-yl-tetramethyluronium hexafluorophosphate,hbtu o-benzotriazole-n,n,n',n'-tetramethyl-uronium-hexafluoro-phosphate,n,n,n',n'-tetramethyl-o-1h-benzotriazol-1-yl uronium hexafluorophosphate,o-1h-benzotriazol-1-yl-n,n,n',n'-tetramethyluronium hexafluorophosphate,o-benzotriazole-n,n,n',n'-tetramethyluronium hexafluorophosphate |
| IUPAC Name | [benzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium;hexafluorophosphate |
| InChI Key | UQYZFNUUOSSNKT-UHFFFAOYSA-N |
| Molecular Formula | C11H16F6N5OP |
N-Hydroxyphthalimide, 98%
CAS: 524-38-9 Molecular Formula: C8H5NO3 Molecular Weight (g/mol): 163.13 MDL Number: MFCD00005891 InChI Key: CFMZSMGAMPBRBE-UHFFFAOYSA-N Synonym: n-hydroxyphthalimide,2-hydroxyisoindoline-1,3-dione,2-hydroxy-1h-isoindole-1,3 2h-dione,nhpi,2-hydroxyphthalimide,1h-isoindole-1,3 2h-dione, 2-hydroxy,phthalimide, n-hydroxy,phthaloxime,unii-bxi99m81x0,2-hydroxyisoindolin-1,3-dione PubChem CID: 10665 IUPAC Name: 2-hydroxyisoindole-1,3-dione SMILES: ON1C(=O)C2=CC=CC=C2C1=O
| PubChem CID | 10665 |
|---|---|
| CAS | 524-38-9 |
| Molecular Weight (g/mol) | 163.13 |
| MDL Number | MFCD00005891 |
| SMILES | ON1C(=O)C2=CC=CC=C2C1=O |
| Synonym | n-hydroxyphthalimide,2-hydroxyisoindoline-1,3-dione,2-hydroxy-1h-isoindole-1,3 2h-dione,nhpi,2-hydroxyphthalimide,1h-isoindole-1,3 2h-dione, 2-hydroxy,phthalimide, n-hydroxy,phthaloxime,unii-bxi99m81x0,2-hydroxyisoindolin-1,3-dione |
| IUPAC Name | 2-hydroxyisoindole-1,3-dione |
| InChI Key | CFMZSMGAMPBRBE-UHFFFAOYSA-N |
| Molecular Formula | C8H5NO3 |
N,N'-Dimethylurea, 98%
CAS: 96-31-1 Molecular Formula: C3H8N2O Molecular Weight (g/mol): 88.11 MDL Number: MFCD00008286 InChI Key: MGJKQDOBUOMPEZ-UHFFFAOYSA-N Synonym: n,n'-dimethylurea,sym-dimethylurea,urea, n,n'-dimethyl,dimethylurea,symmetric dimethylurea,urea, 1,3-dimethyl,n,n'-dimethylharnstoff,1,3-dimethyl urea,n,n'-dimethylharnstoff german,unii-wam6dr9i4x PubChem CID: 7293 ChEBI: CHEBI:80472 IUPAC Name: 1,3-dimethylurea SMILES: CNC(=O)NC
| PubChem CID | 7293 |
|---|---|
| CAS | 96-31-1 |
| Molecular Weight (g/mol) | 88.11 |
| ChEBI | CHEBI:80472 |
| MDL Number | MFCD00008286 |
| SMILES | CNC(=O)NC |
| Synonym | n,n'-dimethylurea,sym-dimethylurea,urea, n,n'-dimethyl,dimethylurea,symmetric dimethylurea,urea, 1,3-dimethyl,n,n'-dimethylharnstoff,1,3-dimethyl urea,n,n'-dimethylharnstoff german,unii-wam6dr9i4x |
| IUPAC Name | 1,3-dimethylurea |
| InChI Key | MGJKQDOBUOMPEZ-UHFFFAOYSA-N |
| Molecular Formula | C3H8N2O |
Ethylene glycol-O,O'-bis(2-aminoethyl)-N,N,N',N'-tetraacetic acid, 97%
CAS: 67-42-5 Molecular Formula: C14H24N2O10 Molecular Weight (g/mol): 380.35 MDL Number: MFCD00004291 InChI Key: DEFVIWRASFVYLL-UHFFFAOYSA-N Synonym: egta,egtazic acid,gedta,ethylenebis oxyethylenenitrilo tetraacetic acid,ebonta,6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl,1,2-bis 2-bis carboxymethyl amino ethoxy ethane,ethylene glycol tetraacetic acid,h4egta,egtazic acid usan:inn PubChem CID: 6207 ChEBI: CHEBI:30740 IUPAC Name: 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid SMILES: C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O
| PubChem CID | 6207 |
|---|---|
| CAS | 67-42-5 |
| Molecular Weight (g/mol) | 380.35 |
| ChEBI | CHEBI:30740 |
| MDL Number | MFCD00004291 |
| SMILES | C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
| Synonym | egta,egtazic acid,gedta,ethylenebis oxyethylenenitrilo tetraacetic acid,ebonta,6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl,1,2-bis 2-bis carboxymethyl amino ethoxy ethane,ethylene glycol tetraacetic acid,h4egta,egtazic acid usan:inn |
| IUPAC Name | 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid |
| InChI Key | DEFVIWRASFVYLL-UHFFFAOYSA-N |
| Molecular Formula | C14H24N2O10 |
N,N-Dimethylacetamide, anhydrous, 99.8%, packaged under Argon in resealable ChemSeal™ bottles
CAS: 127-19-5 Molecular Formula: C4H9NO Molecular Weight (g/mol): 87.12 MDL Number: MFCD00008686 InChI Key: FXHOOIRPVKKKFG-UHFFFAOYSA-N Synonym: dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine PubChem CID: 31374 ChEBI: CHEBI:84254 IUPAC Name: N,N-dimethylacetamide SMILES: CN(C)C(C)=O
| PubChem CID | 31374 |
|---|---|
| CAS | 127-19-5 |
| Molecular Weight (g/mol) | 87.12 |
| ChEBI | CHEBI:84254 |
| MDL Number | MFCD00008686 |
| SMILES | CN(C)C(C)=O |
| Synonym | dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine |
| IUPAC Name | N,N-dimethylacetamide |
| InChI Key | FXHOOIRPVKKKFG-UHFFFAOYSA-N |
| Molecular Formula | C4H9NO |
Ethylene glycol-O,O'-bis(2-aminoethyl)-N,N,N',N'-tetraacetic acid, 0.5M aq. soln., pH 8.0
CAS: 67-42-5 Molecular Formula: C14H24N2O10 Molecular Weight (g/mol): 380.35 MDL Number: MFCD00004291 InChI Key: DEFVIWRASFVYLL-UHFFFAOYSA-N Synonym: egta,egtazic acid,gedta,ethylenebis oxyethylenenitrilo tetraacetic acid,ebonta,6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl,1,2-bis 2-bis carboxymethyl amino ethoxy ethane,ethylene glycol tetraacetic acid,h4egta,egtazic acid usan:inn PubChem CID: 6207 ChEBI: CHEBI:30740 IUPAC Name: 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid SMILES: C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O
| PubChem CID | 6207 |
|---|---|
| CAS | 67-42-5 |
| Molecular Weight (g/mol) | 380.35 |
| ChEBI | CHEBI:30740 |
| MDL Number | MFCD00004291 |
| SMILES | C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
| Synonym | egta,egtazic acid,gedta,ethylenebis oxyethylenenitrilo tetraacetic acid,ebonta,6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl,1,2-bis 2-bis carboxymethyl amino ethoxy ethane,ethylene glycol tetraacetic acid,h4egta,egtazic acid usan:inn |
| IUPAC Name | 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid |
| InChI Key | DEFVIWRASFVYLL-UHFFFAOYSA-N |
| Molecular Formula | C14H24N2O10 |
Sodium n-octyl sulfate, 99%
CAS: 142-31-4 Molecular Formula: C8H17NaO4S Molecular Weight (g/mol): 232.27 MDL Number: MFCD00007470 InChI Key: WFRKJMRGXGWHBM-UHFFFAOYSA-M Synonym: sodium octyl sulfate,sodium n-octyl sulfate,sodium octyl sulphate,sipex ols,cycloryl os,duponol 80,sodium capryl sulfate,octyl sodium sulfate,sulfuric acid, monooctyl ester, sodium salt,octyl sulfate sodium salt PubChem CID: 2735107 IUPAC Name: sodium;octyl sulfate SMILES: CCCCCCCCOS(=O)(=O)[O-].[Na+]
| PubChem CID | 2735107 |
|---|---|
| CAS | 142-31-4 |
| Molecular Weight (g/mol) | 232.27 |
| MDL Number | MFCD00007470 |
| SMILES | CCCCCCCCOS(=O)(=O)[O-].[Na+] |
| Synonym | sodium octyl sulfate,sodium n-octyl sulfate,sodium octyl sulphate,sipex ols,cycloryl os,duponol 80,sodium capryl sulfate,octyl sodium sulfate,sulfuric acid, monooctyl ester, sodium salt,octyl sulfate sodium salt |
| IUPAC Name | sodium;octyl sulfate |
| InChI Key | WFRKJMRGXGWHBM-UHFFFAOYSA-M |
| Molecular Formula | C8H17NaO4S |
Tri-n-butyl phosphate, 98%, Thermo Scientific Chemicals
CAS: 126-73-8 Molecular Formula: C12H27O4P Molecular Weight (g/mol): 266.32 MDL Number: MFCD00009436 InChI Key: STCOOQWBFONSKY-UHFFFAOYSA-N Synonym: tri-n-butyl phosphate,tributylphosphate,butyl phosphate,phosphoric acid tributyl ester,tributylphosphat,celluphos 4,disflamoll tb,tributilfosfato,tributylfosfaat,tributyle phosphate de PubChem CID: 31357 ChEBI: CHEBI:35019 IUPAC Name: tributyl phosphate SMILES: CCCCOP(=O)(OCCCC)OCCCC
| PubChem CID | 31357 |
|---|---|
| CAS | 126-73-8 |
| Molecular Weight (g/mol) | 266.32 |
| ChEBI | CHEBI:35019 |
| MDL Number | MFCD00009436 |
| SMILES | CCCCOP(=O)(OCCCC)OCCCC |
| Synonym | tri-n-butyl phosphate,tributylphosphate,butyl phosphate,phosphoric acid tributyl ester,tributylphosphat,celluphos 4,disflamoll tb,tributilfosfato,tributylfosfaat,tributyle phosphate de |
| IUPAC Name | tributyl phosphate |
| InChI Key | STCOOQWBFONSKY-UHFFFAOYSA-N |
| Molecular Formula | C12H27O4P |
Sodium n-hexadecyl sulfate, 99%, Thermo Scientific Chemicals
CAS: 1120-01-0 Molecular Formula: C16H33NaO3S Molecular Weight (g/mol): 328.49 MDL Number: MFCD00047766 InChI Key: PNGBYKXZVCIZRN-UHFFFAOYSA-M Synonym: sodium hexadecyl sulfate,sodium cetyl sulfate,sodium n-hexadecyl sulfate,unii-3v3y3o7biq,conco sulfate c,avitex c,avitex sf,sodium hexyldecyl sulfate,tergitol anionic 7,3v3y3o7biq PubChem CID: 23695542 IUPAC Name: sodium;hexadecyl sulfate SMILES: [Na+].CCCCCCCCCCCCCCCCS([O-])(=O)=O
| PubChem CID | 23695542 |
|---|---|
| CAS | 1120-01-0 |
| Molecular Weight (g/mol) | 328.49 |
| MDL Number | MFCD00047766 |
| SMILES | [Na+].CCCCCCCCCCCCCCCCS([O-])(=O)=O |
| Synonym | sodium hexadecyl sulfate,sodium cetyl sulfate,sodium n-hexadecyl sulfate,unii-3v3y3o7biq,conco sulfate c,avitex c,avitex sf,sodium hexyldecyl sulfate,tergitol anionic 7,3v3y3o7biq |
| IUPAC Name | sodium;hexadecyl sulfate |
| InChI Key | PNGBYKXZVCIZRN-UHFFFAOYSA-M |
| Molecular Formula | C16H33NaO3S |
Benzyl cinnamate, 99%
CAS: 103-41-3 Molecular Formula: C16H14O2 Molecular Weight (g/mol): 238.29 MDL Number: MFCD00004789,MFCD00004789,MFCD00004789 InChI Key: NGHOLYJTSCBCGC-VAWYXSNFSA-N Synonym: benzyl alcohol cinnamic ester,benzylcinnamate,benzyl alcohol, cinnamate,wln: r1u1vo1r,benzyl .gamma.-phenylacrylate,benzyl cis-cinnamate,benzyl z-cinnamate,2-propenoic acid, 3-phenyl-, phenylmethyl ester,z-benzyl 3-phenylacrylate,cinnamic acid, benzyl ester, z PubChem CID: 15558051 IUPAC Name: benzyl (Z)-3-phenylprop-2-enoate SMILES: O=C(OCC1=CC=CC=C1)\C=C\C1=CC=CC=C1
| PubChem CID | 15558051 |
|---|---|
| CAS | 103-41-3 |
| Molecular Weight (g/mol) | 238.29 |
| MDL Number | MFCD00004789,MFCD00004789,MFCD00004789 |
| SMILES | O=C(OCC1=CC=CC=C1)\C=C\C1=CC=CC=C1 |
| Synonym | benzyl alcohol cinnamic ester,benzylcinnamate,benzyl alcohol, cinnamate,wln: r1u1vo1r,benzyl .gamma.-phenylacrylate,benzyl cis-cinnamate,benzyl z-cinnamate,2-propenoic acid, 3-phenyl-, phenylmethyl ester,z-benzyl 3-phenylacrylate,cinnamic acid, benzyl ester, z |
| IUPAC Name | benzyl (Z)-3-phenylprop-2-enoate |
| InChI Key | NGHOLYJTSCBCGC-VAWYXSNFSA-N |
| Molecular Formula | C16H14O2 |
Benzyl chloroacetate, 98%
CAS: 140-18-1 Molecular Formula: C9H9ClO2 Molecular Weight (g/mol): 184.62 MDL Number: MFCD00157062 InChI Key: SOGXBRHOWDEKQB-UHFFFAOYSA-N Synonym: benzyl chloroacetate,benzyl monochloracetate,acetic acid, chloro-, phenylmethyl ester,chloroacetic acid, benzyl ester,monochloroacetate,chloroacetic acid benzyl ester,benzyl-alpha-chloroacetate,phenylmethyl chloroacetate,acetic acid, chloro-, benzyl ester,phenylmethyl 2-chloroacetate PubChem CID: 8786 IUPAC Name: benzyl 2-chloroacetate SMILES: C1=CC=C(C=C1)COC(=O)CCl
| PubChem CID | 8786 |
|---|---|
| CAS | 140-18-1 |
| Molecular Weight (g/mol) | 184.62 |
| MDL Number | MFCD00157062 |
| SMILES | C1=CC=C(C=C1)COC(=O)CCl |
| Synonym | benzyl chloroacetate,benzyl monochloracetate,acetic acid, chloro-, phenylmethyl ester,chloroacetic acid, benzyl ester,monochloroacetate,chloroacetic acid benzyl ester,benzyl-alpha-chloroacetate,phenylmethyl chloroacetate,acetic acid, chloro-, benzyl ester,phenylmethyl 2-chloroacetate |
| IUPAC Name | benzyl 2-chloroacetate |
| InChI Key | SOGXBRHOWDEKQB-UHFFFAOYSA-N |
| Molecular Formula | C9H9ClO2 |
Benzyl cyanoacetate, 97%
CAS: 14447-18-8 Molecular Formula: C10H9NO2 Molecular Weight (g/mol): 175.19 MDL Number: MFCD00051719 InChI Key: RCUIWQWWDLZNMS-UHFFFAOYSA-N Synonym: benzyl cyanoacetate,acetic acid, cyano-, phenylmethyl ester,cyanoacetic acid benzyl ester,benzyl-cyanoacetate,acetic acid, cyano-, benzyl ester,acmc-20alph,phenylmethyl 2-cyanoacetate,cyano-acetic acid benzyl ester,benzyl ester of cyanoacetic acid PubChem CID: 560818 IUPAC Name: benzyl 2-cyanoacetate SMILES: O=C(CC#N)OCC1=CC=CC=C1
| PubChem CID | 560818 |
|---|---|
| CAS | 14447-18-8 |
| Molecular Weight (g/mol) | 175.19 |
| MDL Number | MFCD00051719 |
| SMILES | O=C(CC#N)OCC1=CC=CC=C1 |
| Synonym | benzyl cyanoacetate,acetic acid, cyano-, phenylmethyl ester,cyanoacetic acid benzyl ester,benzyl-cyanoacetate,acetic acid, cyano-, benzyl ester,acmc-20alph,phenylmethyl 2-cyanoacetate,cyano-acetic acid benzyl ester,benzyl ester of cyanoacetic acid |
| IUPAC Name | benzyl 2-cyanoacetate |
| InChI Key | RCUIWQWWDLZNMS-UHFFFAOYSA-N |
| Molecular Formula | C10H9NO2 |