Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Molybdic acid, for analysis
CAS: 7782-91-4 Molecular Formula: H2MoO4 Molecular Weight (g/mol): 161.96 MDL Number: MFCD00036287 InChI Key: VLAPMBHFAWRUQP-UHFFFAOYSA-L Synonym: molybdic acid,molybdic vi acid,unii-i96n991j1n,dihydroxy dioxo molybdenum,molybdic acid acs,dihydroxy-dioxomolybdenum,molybdate moo42-, dihydrogen, t-4,dihydroxidodioxidomolybdenum,aronis24112,moo2 oh 2 PubChem CID: 82208 ChEBI: CHEBI:25371 IUPAC Name: dihydroxy(dioxo)molybdenum SMILES: O[Mo](O)(=O)=O
| PubChem CID | 82208 |
|---|---|
| CAS | 7782-91-4 |
| Molecular Weight (g/mol) | 161.96 |
| ChEBI | CHEBI:25371 |
| MDL Number | MFCD00036287 |
| SMILES | O[Mo](O)(=O)=O |
| Synonym | molybdic acid,molybdic vi acid,unii-i96n991j1n,dihydroxy dioxo molybdenum,molybdic acid acs,dihydroxy-dioxomolybdenum,molybdate moo42-, dihydrogen, t-4,dihydroxidodioxidomolybdenum,aronis24112,moo2 oh 2 |
| IUPAC Name | dihydroxy(dioxo)molybdenum |
| InChI Key | VLAPMBHFAWRUQP-UHFFFAOYSA-L |
| Molecular Formula | H2MoO4 |
Molybdic acid, ACS reagent
CAS: 7782-91-4 Molecular Formula: H2MoO4 Molecular Weight (g/mol): 161.96 MDL Number: MFCD00036287 InChI Key: VLAPMBHFAWRUQP-UHFFFAOYSA-L Synonym: molybdic acid,molybdic vi acid,unii-i96n991j1n,dihydroxy dioxo molybdenum,molybdic acid acs,dihydroxy-dioxomolybdenum,molybdate moo42-, dihydrogen, t-4,dihydroxidodioxidomolybdenum,aronis24112,moo2 oh 2 PubChem CID: 82208 ChEBI: CHEBI:25371 IUPAC Name: dihydroxy(dioxo)molybdenum SMILES: O[Mo](O)(=O)=O
| PubChem CID | 82208 |
|---|---|
| CAS | 7782-91-4 |
| Molecular Weight (g/mol) | 161.96 |
| ChEBI | CHEBI:25371 |
| MDL Number | MFCD00036287 |
| SMILES | O[Mo](O)(=O)=O |
| Synonym | molybdic acid,molybdic vi acid,unii-i96n991j1n,dihydroxy dioxo molybdenum,molybdic acid acs,dihydroxy-dioxomolybdenum,molybdate moo42-, dihydrogen, t-4,dihydroxidodioxidomolybdenum,aronis24112,moo2 oh 2 |
| IUPAC Name | dihydroxy(dioxo)molybdenum |
| InChI Key | VLAPMBHFAWRUQP-UHFFFAOYSA-L |
| Molecular Formula | H2MoO4 |
Thermo Scientific Chemicals Cholic acid, sodium salt, 98+%
CAS: 361-09-1 Molecular Formula: C24H39NaO5 Molecular Weight (g/mol): 430.56 MDL Number: MFCD00150749,MFCD00064138 InChI Key: NRHMKIHPTBHXPF-TUJRSCDTSA-M Synonym: sodium cholate,sodium 3,7,12-trihydroxycholan-24-oate,sodium cholate, reagent,ksc575s0b,3,7,12-trihydroxycholan-24-oic acid sodium salt PubChem CID: 57349315 IUPAC Name: sodium;(4R)-4-[(8R,9S,10S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate SMILES: [Na+].C[C@H](CCC([O-])=O)[C@H]1CC[C@H]2[C@@H]3[C@H](O)C[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3C[C@H](O)[C@]12C
| PubChem CID | 57349315 |
|---|---|
| CAS | 361-09-1 |
| Molecular Weight (g/mol) | 430.56 |
| MDL Number | MFCD00150749,MFCD00064138 |
| SMILES | [Na+].C[C@H](CCC([O-])=O)[C@H]1CC[C@H]2[C@@H]3[C@H](O)C[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3C[C@H](O)[C@]12C |
| Synonym | sodium cholate,sodium 3,7,12-trihydroxycholan-24-oate,sodium cholate, reagent,ksc575s0b,3,7,12-trihydroxycholan-24-oic acid sodium salt |
| IUPAC Name | sodium;(4R)-4-[(8R,9S,10S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| InChI Key | NRHMKIHPTBHXPF-TUJRSCDTSA-M |
| Molecular Formula | C24H39NaO5 |
Ethylenediaminetetraacetic acid tetrasodium salt dihydrate, (EDTA), 99-101%, Ultrapure
CAS: 10378-23-1 Molecular Formula: C10H20N2Na4O10 Molecular Weight (g/mol): 420.233 MDL Number: MFCD00150026 InChI Key: DGWOWDJDIBPYOR-UHFFFAOYSA-N Synonym: ethylenediaminetetraacetic acid tetrasodium salt dihydrate,tetrasodium ethylenediaminetetraacetate dihydrate,edta-na4,edta tetrasodium salt,edta tetrasodium salt hydrate,ethylenediaminetetraacetic acid tetrasodium salt hydrate,64-02-8 anhydrous,ksc909a7h,edta tetrasodium salt dihydrate,tetrapotassium ion 4-edta dihydrate PubChem CID: 131843362 IUPAC Name: 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;sodium;dihydrate SMILES: C(CN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O.O.O.[Na].[Na].[Na].[Na]
| PubChem CID | 131843362 |
|---|---|
| CAS | 10378-23-1 |
| Molecular Weight (g/mol) | 420.233 |
| MDL Number | MFCD00150026 |
| SMILES | C(CN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O.O.O.[Na].[Na].[Na].[Na] |
| Synonym | ethylenediaminetetraacetic acid tetrasodium salt dihydrate,tetrasodium ethylenediaminetetraacetate dihydrate,edta-na4,edta tetrasodium salt,edta tetrasodium salt hydrate,ethylenediaminetetraacetic acid tetrasodium salt hydrate,64-02-8 anhydrous,ksc909a7h,edta tetrasodium salt dihydrate,tetrapotassium ion 4-edta dihydrate |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;sodium;dihydrate |
| InChI Key | DGWOWDJDIBPYOR-UHFFFAOYSA-N |
| Molecular Formula | C10H20N2Na4O10 |
Ethylenediaminetetraacetic Acid, Disodium Salt Dihydrate, Extra Pure, SLR, Fisher Chemical™
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: 150037 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L IUPAC Name: disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| CAS | 6381-92-6 |
|---|---|
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | 150037 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| IUPAC Name | disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
1-Hexane Sulfonic Acid, Sodium Salt, 98+%, Ion Pair Chromatography, Certified, Fisher Chemical™
CAS: 2832-45-3 Molecular Formula: C6H13NaO3S Molecular Weight (g/mol): 188.22 MDL Number: MFCD00007542 InChI Key: QWSZRRAAFHGKCH-UHFFFAOYSA-M Synonym: sodium 1-hexanesulfonate,sodium hexane-1-sulfonate,sodium hexanesulfonate,1-hexanesulfonic acid sodium salt,1-hexanesulfonic acid, sodium salt,1-hexanesulfonic acid, sodium salt 1:1,1-hexane sulfonic acid sodium salt,hexyl sodium sulfonate,1-hexanesulfonate, sodium,hexanesulfonic acid na-salt PubChem CID: 23677630 SMILES: [Na+].CCCCCCS([O-])(=O)=O
| PubChem CID | 23677630 |
|---|---|
| CAS | 2832-45-3 |
| Molecular Weight (g/mol) | 188.22 |
| MDL Number | MFCD00007542 |
| SMILES | [Na+].CCCCCCS([O-])(=O)=O |
| Synonym | sodium 1-hexanesulfonate,sodium hexane-1-sulfonate,sodium hexanesulfonate,1-hexanesulfonic acid sodium salt,1-hexanesulfonic acid, sodium salt,1-hexanesulfonic acid, sodium salt 1:1,1-hexane sulfonic acid sodium salt,hexyl sodium sulfonate,1-hexanesulfonate, sodium,hexanesulfonic acid na-salt |
| InChI Key | QWSZRRAAFHGKCH-UHFFFAOYSA-M |
| Molecular Formula | C6H13NaO3S |
Ethylenediaminetetraacetic Acid Disodium Salt Solution 0.01M (0.02N), NIST Standard Solution ready to use, for volumetric analysis, Fisher Chemical™
CAS: 139-33-3 Molecular Formula: C10H14N2Na2O8 Molecular Weight (g/mol): 336.21 MDL Number: MFCD00070672,MFCD00003541,MFCD00070672,MFCD00150037 InChI Key: ZGTMUACCHSMWAC-UHFFFAOYSA-L Synonym: ethylenediaminetetraacetic acid disodium salt,edta na2,disodium 2-2-bis carboxymethyl amino ethyl-carboxymethyl amino acetic acid PubChem CID: 57339238 ChEBI: CHEBI:64734 IUPAC Name: disodium;2-[2-[bis(carboxylatomethyl)azaniumyl]ethyl-(carboxylatomethyl)azaniumyl]acetate SMILES: [Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 57339238 |
|---|---|
| CAS | 139-33-3 |
| Molecular Weight (g/mol) | 336.21 |
| ChEBI | CHEBI:64734 |
| MDL Number | MFCD00070672,MFCD00003541,MFCD00070672,MFCD00150037 |
| SMILES | [Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | ethylenediaminetetraacetic acid disodium salt,edta na2,disodium 2-2-bis carboxymethyl amino ethyl-carboxymethyl amino acetic acid |
| IUPAC Name | disodium;2-[2-[bis(carboxylatomethyl)azaniumyl]ethyl-(carboxylatomethyl)azaniumyl]acetate |
| InChI Key | ZGTMUACCHSMWAC-UHFFFAOYSA-L |
| Molecular Formula | C10H14N2Na2O8 |
Orthophosphoric Acid, 85+%, Certified AR for Analysis, Fisher Chemical™
CAS: 7664-38-2 Molecular Formula: H3O4P Molecular Weight (g/mol): 97.994 MDL Number: 11340 InChI Key: NBIIXXVUZAFLBC-UHFFFAOYSA-N Synonym: orthophosphoric acid,sonac,o-phosphoric acid,phosphorsaeure,acidum phosphoricum,evits,wc-reiniger,acide phosphorique,white,acido fosforico PubChem CID: 1004 ChEBI: CHEBI:26078 IUPAC Name: phosphoric acid SMILES: OP(=O)(O)O
| PubChem CID | 1004 |
|---|---|
| CAS | 7664-38-2 |
| Molecular Weight (g/mol) | 97.994 |
| ChEBI | CHEBI:26078 |
| MDL Number | 11340 |
| SMILES | OP(=O)(O)O |
| Synonym | orthophosphoric acid,sonac,o-phosphoric acid,phosphorsaeure,acidum phosphoricum,evits,wc-reiniger,acide phosphorique,white,acido fosforico |
| IUPAC Name | phosphoric acid |
| InChI Key | NBIIXXVUZAFLBC-UHFFFAOYSA-N |
| Molecular Formula | H3O4P |
Tetrachloroauric(III) acid trihydrate, ACS reagent
CAS: 16961-25-4 Molecular Formula: AuCl4H Molecular Weight (g/mol): 339.77 InChI Key: VDLSFRRYNGEBEJ-UHFFFAOYSA-K IUPAC Name: trichlorogold hydrochloride SMILES: Cl.Cl[Au](Cl)Cl
| CAS | 16961-25-4 |
|---|---|
| Molecular Weight (g/mol) | 339.77 |
| SMILES | Cl.Cl[Au](Cl)Cl |
| IUPAC Name | trichlorogold hydrochloride |
| InChI Key | VDLSFRRYNGEBEJ-UHFFFAOYSA-K |
| Molecular Formula | AuCl4H |
Tungstic acid, 99+%
CAS: 7783-03-1 Molecular Formula: H2O4W Molecular Weight (g/mol): 249.86 MDL Number: MFCD00011336 InChI Key: CMPGARWFYBADJI-UHFFFAOYSA-L IUPAC Name: dioxotungstendiol SMILES: O[W](O)(=O)=O
| CAS | 7783-03-1 |
|---|---|
| Molecular Weight (g/mol) | 249.86 |
| MDL Number | MFCD00011336 |
| SMILES | O[W](O)(=O)=O |
| IUPAC Name | dioxotungstendiol |
| InChI Key | CMPGARWFYBADJI-UHFFFAOYSA-L |
| Molecular Formula | H2O4W |
Tungstic(VI) acid
CAS: 7783-03-1 Molecular Formula: H2O4W Molecular Weight (g/mol): 249.85 MDL Number: MFCD00011336 InChI Key: CMPGARWFYBADJI-UHFFFAOYSA-L Synonym: tungstic acid,tungstic vi acid,dihydroxy dioxo tungsten,dihydrogen wolframate,wolframsaure,tunstic acid,dihydroxidodioxidotungsten,tungstic acid h2wo4,unii-j4d6k0rx2g PubChem CID: 1152 ChEBI: CHEBI:36272 IUPAC Name: dihydroxy(dioxo)tungsten SMILES: O[W](=O)(=O)O
| PubChem CID | 1152 |
|---|---|
| CAS | 7783-03-1 |
| Molecular Weight (g/mol) | 249.85 |
| ChEBI | CHEBI:36272 |
| MDL Number | MFCD00011336 |
| SMILES | O[W](=O)(=O)O |
| Synonym | tungstic acid,tungstic vi acid,dihydroxy dioxo tungsten,dihydrogen wolframate,wolframsaure,tunstic acid,dihydroxidodioxidotungsten,tungstic acid h2wo4,unii-j4d6k0rx2g |
| IUPAC Name | dihydroxy(dioxo)tungsten |
| InChI Key | CMPGARWFYBADJI-UHFFFAOYSA-L |
| Molecular Formula | H2O4W |
Ethylenediaminetetraacetic Acid, Disodium Salt Dihydrate, Certified AR for Analysis, Fisher Chemical™
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: 150037 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L IUPAC Name: disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| CAS | 6381-92-6 |
|---|---|
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | 150037 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| IUPAC Name | disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
Orthophosphoric Acid, 85+%, Extra Pure, SLR, Fisher Chemical™
CAS: 7664-38-2 Molecular Formula: H3O4P Molecular Weight (g/mol): 97.994 MDL Number: 11340 InChI Key: NBIIXXVUZAFLBC-UHFFFAOYSA-N Synonym: orthophosphoric acid,sonac,o-phosphoric acid,phosphorsaeure,acidum phosphoricum,evits,wc-reiniger,acide phosphorique,white,acido fosforico PubChem CID: 1004 ChEBI: CHEBI:26078 IUPAC Name: phosphoric acid SMILES: OP(=O)(O)O
| PubChem CID | 1004 |
|---|---|
| CAS | 7664-38-2 |
| Molecular Weight (g/mol) | 97.994 |
| ChEBI | CHEBI:26078 |
| MDL Number | 11340 |
| SMILES | OP(=O)(O)O |
| Synonym | orthophosphoric acid,sonac,o-phosphoric acid,phosphorsaeure,acidum phosphoricum,evits,wc-reiniger,acide phosphorique,white,acido fosforico |
| IUPAC Name | phosphoric acid |
| InChI Key | NBIIXXVUZAFLBC-UHFFFAOYSA-N |
| Molecular Formula | H3O4P |
Phosphoenolpyruvic acid tricyclohexylammonium salt
CAS: 35556-70-8 Molecular Formula: C21H44N3O6P Molecular Weight (g/mol): 465.57 MDL Number: MFCD00004258 InChI Key: MJKYGUXBFYGLLM-UHFFFAOYSA-N Synonym: phosphoenolpyruvic acid tris cyclohexylammonium salt,tris cyclohexylamine ; phosphoenolpyruvic acid,phosphoenolpyruvic acid, tris cyclohexylammonium salt,pep-3cha,phosphoenol pyruvate tri cyclohexylammonium salt,phosphoenolpyruvic acid tricyclohexylammonium salt,phosphoenolpyruvic acid tris cyclohexylamine salt,2-phosphonooxy-2-propenoic acid tri cyclohexylammonium salt,axi c 1/4 +/-ui feminineea ey>>. 1/4 masculine degrees .ni,phospho enol pyruvic acid tri cyclohexylammonium salt enzymatic PubChem CID: 11754241 IUPAC Name: 2-(phosphonooxy)prop-2-enoic acid; tris(cyclohexanamine) SMILES: NC1CCCCC1.NC1CCCCC1.NC1CCCCC1.OC(=O)C(=C)OP(O)(O)=O
| PubChem CID | 11754241 |
|---|---|
| CAS | 35556-70-8 |
| Molecular Weight (g/mol) | 465.57 |
| MDL Number | MFCD00004258 |
| SMILES | NC1CCCCC1.NC1CCCCC1.NC1CCCCC1.OC(=O)C(=C)OP(O)(O)=O |
| Synonym | phosphoenolpyruvic acid tris cyclohexylammonium salt,tris cyclohexylamine ; phosphoenolpyruvic acid,phosphoenolpyruvic acid, tris cyclohexylammonium salt,pep-3cha,phosphoenol pyruvate tri cyclohexylammonium salt,phosphoenolpyruvic acid tricyclohexylammonium salt,phosphoenolpyruvic acid tris cyclohexylamine salt,2-phosphonooxy-2-propenoic acid tri cyclohexylammonium salt,axi c 1/4 +/-ui feminineea ey>>. 1/4 masculine degrees .ni,phospho enol pyruvic acid tri cyclohexylammonium salt enzymatic |
| IUPAC Name | 2-(phosphonooxy)prop-2-enoic acid; tris(cyclohexanamine) |
| InChI Key | MJKYGUXBFYGLLM-UHFFFAOYSA-N |
| Molecular Formula | C21H44N3O6P |
Oxonic acid potassium salt
CAS: 2207-75-2 Molecular Formula: C4H2KN3O4 Molecular Weight (g/mol): 195.18 MDL Number: MFCD00010565 InChI Key: IAPCTXZQXAVYNG-UHFFFAOYSA-M Synonym: potassium oxonate,oteracil potassium,oxonic acid potassium salt,allantoxanic acid potassium salt,potassium azaorotate,oxonic acid, potassium salt,oxonate, potassium,oxonate,allantoxanic acid PubChem CID: 2723920 ChEBI: CHEBI:80230 SMILES: [K+].[O-]C(=O)C1=NC(=O)NC(=O)N1
| PubChem CID | 2723920 |
|---|---|
| CAS | 2207-75-2 |
| Molecular Weight (g/mol) | 195.18 |
| ChEBI | CHEBI:80230 |
| MDL Number | MFCD00010565 |
| SMILES | [K+].[O-]C(=O)C1=NC(=O)NC(=O)N1 |
| Synonym | potassium oxonate,oteracil potassium,oxonic acid potassium salt,allantoxanic acid potassium salt,potassium azaorotate,oxonic acid, potassium salt,oxonate, potassium,oxonate,allantoxanic acid |
| InChI Key | IAPCTXZQXAVYNG-UHFFFAOYSA-M |
| Molecular Formula | C4H2KN3O4 |