Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
trans-4-(Trifluoromethyl)cinnamic acid, 98%
CAS: 16642-92-5 Molecular Formula: C10H6F3O2 Molecular Weight (g/mol): 215.15 MDL Number: MFCD00002696 InChI Key: ANRMAUMHJREENI-ZZXKWVIFSA-M Synonym: 4-trifluoromethyl cinnamic acid,trans-4-trifluoromethyl cinnamic acid,p-trifluoromethyl cinnamic acid,e-3-4-trifluoromethyl phenyl acrylic acid,2e-3-4-trifluoromethyl phenyl prop-2-enoic acid,4-trifluoromethylcinnamic acid,2-propenoic acid, 3-4-trifluoromethyl phenyl,3-4-trifluoromethyl-phenyl-acrylic acid,ptf-cna,trans-4-trifluoromethylcinnamic acid PubChem CID: 688070 ChEBI: CHEBI:60705 IUPAC Name: (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoic acid SMILES: [O-]C(=O)\C=C\C1=CC=C(C=C1)C(F)(F)F
| PubChem CID | 688070 |
|---|---|
| CAS | 16642-92-5 |
| Molecular Weight (g/mol) | 215.15 |
| ChEBI | CHEBI:60705 |
| MDL Number | MFCD00002696 |
| SMILES | [O-]C(=O)\C=C\C1=CC=C(C=C1)C(F)(F)F |
| Synonym | 4-trifluoromethyl cinnamic acid,trans-4-trifluoromethyl cinnamic acid,p-trifluoromethyl cinnamic acid,e-3-4-trifluoromethyl phenyl acrylic acid,2e-3-4-trifluoromethyl phenyl prop-2-enoic acid,4-trifluoromethylcinnamic acid,2-propenoic acid, 3-4-trifluoromethyl phenyl,3-4-trifluoromethyl-phenyl-acrylic acid,ptf-cna,trans-4-trifluoromethylcinnamic acid |
| IUPAC Name | (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoic acid |
| InChI Key | ANRMAUMHJREENI-ZZXKWVIFSA-M |
| Molecular Formula | C10H6F3O2 |
3-(Trifluoromethyl)cinnamic acid, predominantly trans, 98+%
CAS: 779-89-5 Molecular Formula: C10H7F3O2 Molecular Weight (g/mol): 216.159 MDL Number: MFCD00004393 InChI Key: KSBWHDDGWSYETA-SNAWJCMRSA-N Synonym: 3-trifluoromethyl cinnamic acid,3-3-trifluoromethyl phenyl acrylic acid,m-trifluoromethyl cinnamic acid,e-3-trifluoromethyl cinnamic acid,unii-p9lj9on37w,2e-3-3-trifluoromethyl phenyl prop-2-enoic acid,e-m-trifluoromethyl cinnamic acid,3-e-trifluoromethyl cinnamic acid PubChem CID: 719451 ChEBI: CHEBI:60704 IUPAC Name: (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoic acid SMILES: C1=CC(=CC(=C1)C(F)(F)F)C=CC(=O)O
| PubChem CID | 719451 |
|---|---|
| CAS | 779-89-5 |
| Molecular Weight (g/mol) | 216.159 |
| ChEBI | CHEBI:60704 |
| MDL Number | MFCD00004393 |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C=CC(=O)O |
| Synonym | 3-trifluoromethyl cinnamic acid,3-3-trifluoromethyl phenyl acrylic acid,m-trifluoromethyl cinnamic acid,e-3-trifluoromethyl cinnamic acid,unii-p9lj9on37w,2e-3-3-trifluoromethyl phenyl prop-2-enoic acid,e-m-trifluoromethyl cinnamic acid,3-e-trifluoromethyl cinnamic acid |
| IUPAC Name | (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoic acid |
| InChI Key | KSBWHDDGWSYETA-SNAWJCMRSA-N |
| Molecular Formula | C10H7F3O2 |
3,4-(Methylenedioxy)cinnamic acid, predominantly trans, 99%
CAS: 2373-80-0 Molecular Formula: C10H8O4 Molecular Weight (g/mol): 192.17 MDL Number: MFCD00005837 InChI Key: QFQYZMGOKIROEC-DUXPYHPUSA-N Synonym: 3,4-methylenedioxycinnamic acid,3,4-methylenedioxy cinnamic acid,3-benzo d 1,3 dioxol-5-yl acrylic acid,unii-x8h0wpj08y,3-1,3-benzodioxol-5-yl acrylic acid,2e-3-2h-1,3-benzodioxol-5-yl prop-2-enoic acid,methylenedioxycinnamic acid,x8h0wpj08y,2e-3-1,3-benzodioxol-5-yl acrylic acid,2e-3-1,3-benzodioxol-5-yl-2-propenoic acid PubChem CID: 643181 ChEBI: CHEBI:81482 IUPAC Name: (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoic acid SMILES: C1OC2=C(O1)C=C(C=C2)C=CC(=O)O
| PubChem CID | 643181 |
|---|---|
| CAS | 2373-80-0 |
| Molecular Weight (g/mol) | 192.17 |
| ChEBI | CHEBI:81482 |
| MDL Number | MFCD00005837 |
| SMILES | C1OC2=C(O1)C=C(C=C2)C=CC(=O)O |
| Synonym | 3,4-methylenedioxycinnamic acid,3,4-methylenedioxy cinnamic acid,3-benzo d 1,3 dioxol-5-yl acrylic acid,unii-x8h0wpj08y,3-1,3-benzodioxol-5-yl acrylic acid,2e-3-2h-1,3-benzodioxol-5-yl prop-2-enoic acid,methylenedioxycinnamic acid,x8h0wpj08y,2e-3-1,3-benzodioxol-5-yl acrylic acid,2e-3-1,3-benzodioxol-5-yl-2-propenoic acid |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoic acid |
| InChI Key | QFQYZMGOKIROEC-DUXPYHPUSA-N |
| Molecular Formula | C10H8O4 |
Cinnamic Acid, TRC
CAS: 621-82-9 Molecular Formula: C9 H8 O2 Molecular Weight (g/mol): 148.159 Synonym: 3-Phenyl-2-propenoic Acid,3-Phenylacrylic Acid,NSC 623441,NSC 9189,Phenylacrylic Acid,β-Phenylacrylic Acid IUPAC Name: 3-phenylprop-2-enoic acid SMILES: OC(=O)C=Cc1ccccc1
| CAS | 621-82-9 |
|---|---|
| Molecular Weight (g/mol) | 148.159 |
| SMILES | OC(=O)C=Cc1ccccc1 |
| Synonym | 3-Phenyl-2-propenoic Acid,3-Phenylacrylic Acid,NSC 623441,NSC 9189,Phenylacrylic Acid,β-Phenylacrylic Acid |
| IUPAC Name | 3-phenylprop-2-enoic acid |
| Molecular Formula | C9 H8 O2 |
| CAS | 140-10-3 |
|---|---|
| Molecular Formula | C9H8O2 |
3,4-Dimethoxy[7,8,9,-13C3]-cinnamic Acid, TRC
CAS: 1185241-38-6 Molecular Formula: 13C3 C8 H12 O4 Molecular Weight (g/mol): 211.19 Synonym: 3-(3,4-Dimethoxyphenyl)-2-propenoic-1,2,3-13C3 acid,3,4-Di-O-methylcaffeic-13C3 acid,3,4-Dimethoxycinnamic-13C3 acid,3-(3,4-Dimethoxyphenyl)acrylic-13C3 acid,Caffeic acid-13C3 dimethyl ether,Methylferulic acid-13C3,3,4-Dimethoxycinnamic acid-13C3,3,4-Dimethoxycinnamic acid 13C3 (propenoate-13C3),3,4-Dimethoxy[7,8,9-13C3]cinnamic acid IUPAC Name: (E)-3-(3,4-dimethoxyphenyl)(1,2,3-^{13}C_{3})prop-2-enoic acid SMILES: COc1ccc(\[13CH]=[13CH]\[13C](=O)O)cc1OC
| CAS | 1185241-38-6 |
|---|---|
| Molecular Weight (g/mol) | 211.19 |
| SMILES | COc1ccc(\[13CH]=[13CH]\[13C](=O)O)cc1OC |
| Synonym | 3-(3,4-Dimethoxyphenyl)-2-propenoic-1,2,3-13C3 acid,3,4-Di-O-methylcaffeic-13C3 acid,3,4-Dimethoxycinnamic-13C3 acid,3-(3,4-Dimethoxyphenyl)acrylic-13C3 acid,Caffeic acid-13C3 dimethyl ether,Methylferulic acid-13C3,3,4-Dimethoxycinnamic acid-13C3,3,4-Dimethoxycinnamic acid 13C3 (propenoate-13C3),3,4-Dimethoxy[7,8,9-13C3]cinnamic acid |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)(1,2,3-^{13}C_{3})prop-2-enoic acid |
| Molecular Formula | 13C3 C8 H12 O4 |
Guanfacine Hydrochloride, TRC
CAS: 29110-48-3 Molecular Weight (g/mol): 282.55 Synonym: N-(Aminoiminomethyl)-2,6-dichloro-benzeneacetamide Hydrochloride (1:1),Benzeneacetamide, N-(aminoiminomethyl)-2,6-dichloro-, monohydrochloride (9CI),2,6-Dichlorophenylacetylguanidine hydrochloride,BS 100-141,Estulic,Guanfacine hydrochloride,INTUNIV,LON 798,N-Amidino-2-(2,6-dichlorophenyl)acetamide hydrochloride,SPD 503,Tenex,Tenex (pharmaceutical),[(2,6-Dichlorophenyl)acetyl]guanidine monohydrochloride IUPAC Name: N-carbamimidoyl-2-(2,6-dichlorophenyl)acetamide;hydrochloride SMILES: Cl.NC(=N)NC(=O)Cc1c(Cl)cccc1Cl
| CAS | 29110-48-3 |
|---|---|
| Molecular Weight (g/mol) | 282.55 |
| SMILES | Cl.NC(=N)NC(=O)Cc1c(Cl)cccc1Cl |
| Synonym | N-(Aminoiminomethyl)-2,6-dichloro-benzeneacetamide Hydrochloride (1:1),Benzeneacetamide, N-(aminoiminomethyl)-2,6-dichloro-, monohydrochloride (9CI),2,6-Dichlorophenylacetylguanidine hydrochloride,BS 100-141,Estulic,Guanfacine hydrochloride,INTUNIV,LON 798,N-Amidino-2-(2,6-dichlorophenyl)acetamide hydrochloride,SPD 503,Tenex,Tenex (pharmaceutical),[(2,6-Dichlorophenyl)acetyl]guanidine monohydrochloride |
| IUPAC Name | N-carbamimidoyl-2-(2,6-dichlorophenyl)acetamide;hydrochloride |
Methyl cinnamate, 98%
CAS: 103-26-4 Molecular Formula: C10H10O2 Molecular Weight (g/mol): 162.19 MDL Number: MFCD00008458 InChI Key: CCRCUPLGCSFEDV-BQYQJAHWSA-N Synonym: methyl cinnamate,methyl trans-cinnamate,methyl e-cinnamate,cinnamic acid methyl ester,methyl cinnamylate,methyl 3-phenylacrylate,methyl e-3-phenylprop-2-enoate,methyl 3-phenylpropenoate,trans-cinnamic acid methyl ester,trans-methyl cinnamate PubChem CID: 637520 ChEBI: CHEBI:6857 IUPAC Name: methyl (E)-3-phenylprop-2-enoate SMILES: COC(=O)C=CC1=CC=CC=C1
| PubChem CID | 637520 |
|---|---|
| CAS | 103-26-4 |
| Molecular Weight (g/mol) | 162.19 |
| ChEBI | CHEBI:6857 |
| MDL Number | MFCD00008458 |
| SMILES | COC(=O)C=CC1=CC=CC=C1 |
| Synonym | methyl cinnamate,methyl trans-cinnamate,methyl e-cinnamate,cinnamic acid methyl ester,methyl cinnamylate,methyl 3-phenylacrylate,methyl e-3-phenylprop-2-enoate,methyl 3-phenylpropenoate,trans-cinnamic acid methyl ester,trans-methyl cinnamate |
| IUPAC Name | methyl (E)-3-phenylprop-2-enoate |
| InChI Key | CCRCUPLGCSFEDV-BQYQJAHWSA-N |
| Molecular Formula | C10H10O2 |
Ethyl cinnamate, 98+%
CAS: 103-36-6 Molecular Formula: C11H12O2 Molecular Weight (g/mol): 176.215 MDL Number: MFCD00009189 InChI Key: KBEBGUQPQBELIU-CMDGGOBGSA-N Synonym: ethyl cinnamate,ethyl 3-phenylacrylate,ethylcinnamate,cinnamic acid ethyl ester,ethylcinnamoate,cinnamic acid, ethyl ester,ethyl trans-cinnamate,e-ethyl cinnamate,ethyl 3-phenyl-2-propenoate,ethyl benzylideneacetate PubChem CID: 637758 ChEBI: CHEBI:4895 IUPAC Name: ethyl (E)-3-phenylprop-2-enoate SMILES: CCOC(=O)C=CC1=CC=CC=C1
| PubChem CID | 637758 |
|---|---|
| CAS | 103-36-6 |
| Molecular Weight (g/mol) | 176.215 |
| ChEBI | CHEBI:4895 |
| MDL Number | MFCD00009189 |
| SMILES | CCOC(=O)C=CC1=CC=CC=C1 |
| Synonym | ethyl cinnamate,ethyl 3-phenylacrylate,ethylcinnamate,cinnamic acid ethyl ester,ethylcinnamoate,cinnamic acid, ethyl ester,ethyl trans-cinnamate,e-ethyl cinnamate,ethyl 3-phenyl-2-propenoate,ethyl benzylideneacetate |
| IUPAC Name | ethyl (E)-3-phenylprop-2-enoate |
| InChI Key | KBEBGUQPQBELIU-CMDGGOBGSA-N |
| Molecular Formula | C11H12O2 |
7-Hydroxy Amoxapine, TRC
CAS: 37081-76-8 Molecular Weight (g/mol): 329.78 IUPAC Name: 8-chloro-6-piperazin-1-ylbenzo[b][1,4]benzoxazepin-2-ol SMILES: Oc1ccc2N=C(N3CCNCC3)c4cc(Cl)ccc4Oc2c1
| CAS | 37081-76-8 |
|---|---|
| Molecular Weight (g/mol) | 329.78 |
| SMILES | Oc1ccc2N=C(N3CCNCC3)c4cc(Cl)ccc4Oc2c1 |
| IUPAC Name | 8-chloro-6-piperazin-1-ylbenzo[b][1,4]benzoxazepin-2-ol |
Ethyl cinnamate, 98% trans
CAS: 103-36-6 Molecular Formula: C11H12O2 Molecular Weight (g/mol): 176.21 InChI Key: KBEBGUQPQBELIU-CMDGGOBGSA-N Synonym: ethyl cinnamate,ethyl 3-phenylacrylate,ethylcinnamate,cinnamic acid ethyl ester,ethylcinnamoate,cinnamic acid, ethyl ester,ethyl trans-cinnamate,e-ethyl cinnamate,ethyl 3-phenyl-2-propenoate,ethyl benzylideneacetate PubChem CID: 637758 ChEBI: CHEBI:4895 IUPAC Name: ethyl (E)-3-phenylprop-2-enoate SMILES: CCOC(=O)C=CC1=CC=CC=C1
| PubChem CID | 637758 |
|---|---|
| CAS | 103-36-6 |
| Molecular Weight (g/mol) | 176.21 |
| ChEBI | CHEBI:4895 |
| SMILES | CCOC(=O)C=CC1=CC=CC=C1 |
| Synonym | ethyl cinnamate,ethyl 3-phenylacrylate,ethylcinnamate,cinnamic acid ethyl ester,ethylcinnamoate,cinnamic acid, ethyl ester,ethyl trans-cinnamate,e-ethyl cinnamate,ethyl 3-phenyl-2-propenoate,ethyl benzylideneacetate |
| IUPAC Name | ethyl (E)-3-phenylprop-2-enoate |
| InChI Key | KBEBGUQPQBELIU-CMDGGOBGSA-N |
| Molecular Formula | C11H12O2 |
L-(+)-Ascorbic acid, 99+%
CAS: 50-81-7 Molecular Formula: C6H8O6 Molecular Weight (g/mol): 176.12 MDL Number: MFCD00064328 InChI Key: CIWBSHSKHKDKBQ-DOMZIZNONA-N Synonym: l-ascorbic acid,ascorbic acid,vitamin c,l-ascorbate,ascorbate,ascorbicap,l +-ascorbic acid,cevitamic acid,ascoltin,hybrin PubChem CID: 54670067 ChEBI: CHEBI:29073 SMILES: OC[C@H](O)[C@H]1OC(=O)C(O)=C1O
| PubChem CID | 54670067 |
|---|---|
| CAS | 50-81-7 |
| Molecular Weight (g/mol) | 176.12 |
| ChEBI | CHEBI:29073 |
| MDL Number | MFCD00064328 |
| SMILES | OC[C@H](O)[C@H]1OC(=O)C(O)=C1O |
| Synonym | l-ascorbic acid,ascorbic acid,vitamin c,l-ascorbate,ascorbate,ascorbicap,l +-ascorbic acid,cevitamic acid,ascoltin,hybrin |
| InChI Key | CIWBSHSKHKDKBQ-DOMZIZNONA-N |
| Molecular Formula | C6H8O6 |
Thermo Scientific Chemicals Ethylenediaminetetraacetic acid, 99%, pure
CAS: 60-00-4 Molecular Formula: C10H16N2O8 Molecular Weight (g/mol): 292.24 MDL Number: MFCD00003541 InChI Key: KCXVZYZYPLLWCC-UHFFFAOYSA-N Synonym: edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol PubChem CID: 6049 ChEBI: CHEBI:42191 IUPAC Name: 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid SMILES: OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O
| PubChem CID | 6049 |
|---|---|
| CAS | 60-00-4 |
| Molecular Weight (g/mol) | 292.24 |
| ChEBI | CHEBI:42191 |
| MDL Number | MFCD00003541 |
| SMILES | OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
| Synonym | edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid |
| InChI Key | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| Molecular Formula | C10H16N2O8 |
Malonic acid, 99%
CAS: 141-82-2 Molecular Formula: C3H4O4 Molecular Weight (g/mol): 104.061 MDL Number: MFCD00002707 InChI Key: OFOBLEOULBTSOW-UHFFFAOYSA-N Synonym: malonic acid,dicarboxymethane,carboxyacetic acid,methanedicarboxylic acid,kyselina malonova,usaf ek-695,dicarboxylate,dicarboxylic acid,kyselina malonova czech,propanediolic acid PubChem CID: 867 ChEBI: CHEBI:30794 IUPAC Name: propanedioic acid SMILES: C(C(=O)O)C(=O)O
| PubChem CID | 867 |
|---|---|
| CAS | 141-82-2 |
| Molecular Weight (g/mol) | 104.061 |
| ChEBI | CHEBI:30794 |
| MDL Number | MFCD00002707 |
| SMILES | C(C(=O)O)C(=O)O |
| Synonym | malonic acid,dicarboxymethane,carboxyacetic acid,methanedicarboxylic acid,kyselina malonova,usaf ek-695,dicarboxylate,dicarboxylic acid,kyselina malonova czech,propanediolic acid |
| IUPAC Name | propanedioic acid |
| InChI Key | OFOBLEOULBTSOW-UHFFFAOYSA-N |
| Molecular Formula | C3H4O4 |
Calconcarboxylic acid
CAS: 3737-95-9 Molecular Formula: C21H14N2O7S Molecular Weight (g/mol): 438.41 MDL Number: MFCD00004078 InChI Key: ULIVOAKVRBXKKS-PYCFMQQDSA-N Synonym: calconcarboxylic acid,patton-reeder indicator,calconcarbonic acid,calcon 3-carboxylic acid,patton and reeder's indicator,2-hydroxy-1-2-hydroxy-4-sulfo-1-napthylazo-3-naphthoic acid,2,2'-dihydroxy-4'-sulpho-1,1'-azonaphthalene-3-carboxylic acid,2-naphthalenecarboxylic acid, 3-hydroxy-4-2-hydroxy-4-sulfo-1-naphthalenyl azo,nn PubChem CID: 5895210 IUPAC Name: 3-hydroxy-4-[(2Z)-2-(2-oxo-4-sulfonaphthalen-1-ylidene)hydrazinyl]naphthalene-2-carboxylic acid SMILES: C1=CC=C2C(=C1)C=C(C(=C2NN=C3C4=CC=CC=C4C(=CC3=O)S(=O)(=O)O)O)C(=O)O
| PubChem CID | 5895210 |
|---|---|
| CAS | 3737-95-9 |
| Molecular Weight (g/mol) | 438.41 |
| MDL Number | MFCD00004078 |
| SMILES | C1=CC=C2C(=C1)C=C(C(=C2NN=C3C4=CC=CC=C4C(=CC3=O)S(=O)(=O)O)O)C(=O)O |
| Synonym | calconcarboxylic acid,patton-reeder indicator,calconcarbonic acid,calcon 3-carboxylic acid,patton and reeder's indicator,2-hydroxy-1-2-hydroxy-4-sulfo-1-napthylazo-3-naphthoic acid,2,2'-dihydroxy-4'-sulpho-1,1'-azonaphthalene-3-carboxylic acid,2-naphthalenecarboxylic acid, 3-hydroxy-4-2-hydroxy-4-sulfo-1-naphthalenyl azo,nn |
| IUPAC Name | 3-hydroxy-4-[(2Z)-2-(2-oxo-4-sulfonaphthalen-1-ylidene)hydrazinyl]naphthalene-2-carboxylic acid |
| InChI Key | ULIVOAKVRBXKKS-PYCFMQQDSA-N |
| Molecular Formula | C21H14N2O7S |