Chemicals
Filtered Search Results
Tetrakis(triphenylphosphine)palladium(0), 99%
CAS: 14221-01-3 Molecular Formula: C72H60P4Pd Molecular Weight (g/mol): 1155.59 MDL Number: MFCD00010012 InChI Key: NFHFRUOZVGFOOS-UHFFFAOYSA-N Synonym: tetrakis triphenylphosphine palladium,tetrakis triphenylphosphine palladium 0,pd pph3 4,tetrakis triphenylphosphine palladium o,tetra triphenylphosphine palladium,palladium-tetrakis triphenylphosphine,palladium 0 tetrakis triphenylphosphine,palladium, tetrakis triphenylphosphine-, t-4 PubChem CID: 11979704 IUPAC Name: palladium;triphenylphosphane SMILES: [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 11979704 |
|---|---|
| CAS | 14221-01-3 |
| Molecular Weight (g/mol) | 1155.59 |
| MDL Number | MFCD00010012 |
| SMILES | [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | tetrakis triphenylphosphine palladium,tetrakis triphenylphosphine palladium 0,pd pph3 4,tetrakis triphenylphosphine palladium o,tetra triphenylphosphine palladium,palladium-tetrakis triphenylphosphine,palladium 0 tetrakis triphenylphosphine,palladium, tetrakis triphenylphosphine-, t-4 |
| IUPAC Name | palladium;triphenylphosphane |
| InChI Key | NFHFRUOZVGFOOS-UHFFFAOYSA-N |
| Molecular Formula | C72H60P4Pd |
Bis(dibenzylideneacetone)palladium(0)
CAS: 32005-36-0 Molecular Formula: C34H28O2Pd Molecular Weight (g/mol): 575.02 MDL Number: MFCD00051942 InChI Key: UKSZBOKPHAQOMP-SVLSSHOZSA-N Synonym: bis dibenzylideneacetone palladium,bis dibenzylideneacetone palladium 0,pd dba 2,1e,4e-1,5-diphenylpenta-1,4-dien-3-one; palladium,bis dibenzyldeneacetone palladium 0,tris dibenzylideneacetone dipalladium o,palladium 0 bis dibenzylideneacetone,pubchem14428 PubChem CID: 6505921 IUPAC Name: (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one;palladium SMILES: [Pd].O=C(\C=C\C1=CC=CC=C1)/C=C/C1=CC=CC=C1.O=C(\C=C\C1=CC=CC=C1)/C=C/C1=CC=CC=C1
| PubChem CID | 6505921 |
|---|---|
| CAS | 32005-36-0 |
| Molecular Weight (g/mol) | 575.02 |
| MDL Number | MFCD00051942 |
| SMILES | [Pd].O=C(\C=C\C1=CC=CC=C1)/C=C/C1=CC=CC=C1.O=C(\C=C\C1=CC=CC=C1)/C=C/C1=CC=CC=C1 |
| Synonym | bis dibenzylideneacetone palladium,bis dibenzylideneacetone palladium 0,pd dba 2,1e,4e-1,5-diphenylpenta-1,4-dien-3-one; palladium,bis dibenzyldeneacetone palladium 0,tris dibenzylideneacetone dipalladium o,palladium 0 bis dibenzylideneacetone,pubchem14428 |
| IUPAC Name | (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one;palladium |
| InChI Key | UKSZBOKPHAQOMP-SVLSSHOZSA-N |
| Molecular Formula | C34H28O2Pd |
Bis(tri-tert-butylphosphine)palladium(0)
CAS: 53199-31-8 Molecular Formula: C24H54P2Pd Molecular Weight (g/mol): 511.06 MDL Number: MFCD03094580 InChI Key: MXQOYLRVSVOCQT-UHFFFAOYSA-N Synonym: bis tri-tert-butylphosphine palladium 0,bis tri-t-butylphosphine palladium 0,bis tri-tert-butylphosphine palladium,bis tri-tert-butylphosphane palladium,palladium; tritert-butylphosphane,palladium, bis tris 1,1-dimethylethyl phosphine,pd p tbu 3 2,pd t-bu3p 2,bis tri-t-butylphosphine palladium,di tri-tert-butylphosphine palladium 0 PubChem CID: 2734558 IUPAC Name: palladium;tritert-butylphosphane SMILES: [Pd].CC(C)(C)P(C(C)(C)C)C(C)(C)C.CC(C)(C)P(C(C)(C)C)C(C)(C)C
| PubChem CID | 2734558 |
|---|---|
| CAS | 53199-31-8 |
| Molecular Weight (g/mol) | 511.06 |
| MDL Number | MFCD03094580 |
| SMILES | [Pd].CC(C)(C)P(C(C)(C)C)C(C)(C)C.CC(C)(C)P(C(C)(C)C)C(C)(C)C |
| Synonym | bis tri-tert-butylphosphine palladium 0,bis tri-t-butylphosphine palladium 0,bis tri-tert-butylphosphine palladium,bis tri-tert-butylphosphane palladium,palladium; tritert-butylphosphane,palladium, bis tris 1,1-dimethylethyl phosphine,pd p tbu 3 2,pd t-bu3p 2,bis tri-t-butylphosphine palladium,di tri-tert-butylphosphine palladium 0 |
| IUPAC Name | palladium;tritert-butylphosphane |
| InChI Key | MXQOYLRVSVOCQT-UHFFFAOYSA-N |
| Molecular Formula | C24H54P2Pd |
Bis(tricyclohexylphosphine)palladium(0), 97% min
CAS: 33309-88-5 Molecular Formula: C36H66P2Pd Molecular Weight (g/mol): 667.29 MDL Number: MFCD01073796 InChI Key: JGBZTJWQMWZVNX-UHFFFAOYSA-N Synonym: bis tricyclohexylphosphine palladium 0,bis tricyclohexylphosphine palladium o,bis tricyclohexylphosphine palladium,palladium, bis tricyclohexylphosphine,pd pcy3 2,palladium; tricyclohexylphosphane,palladium-tricyclohexylphosphine 1:2,bis tricyclohexylphosphine-palladium o PubChem CID: 2734559 IUPAC Name: palladium;tricyclohexylphosphane SMILES: [Pd].C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.C1CCC(CC1)P(C1CCCCC1)C1CCCCC1
| PubChem CID | 2734559 |
|---|---|
| CAS | 33309-88-5 |
| Molecular Weight (g/mol) | 667.29 |
| MDL Number | MFCD01073796 |
| SMILES | [Pd].C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.C1CCC(CC1)P(C1CCCCC1)C1CCCCC1 |
| Synonym | bis tricyclohexylphosphine palladium 0,bis tricyclohexylphosphine palladium o,bis tricyclohexylphosphine palladium,palladium, bis tricyclohexylphosphine,pd pcy3 2,palladium; tricyclohexylphosphane,palladium-tricyclohexylphosphine 1:2,bis tricyclohexylphosphine-palladium o |
| IUPAC Name | palladium;tricyclohexylphosphane |
| InChI Key | JGBZTJWQMWZVNX-UHFFFAOYSA-N |
| Molecular Formula | C36H66P2Pd |
Bis(tri-tert-butylphosphine)palladium(0), 98%
CAS: 53199-31-8 Molecular Formula: C24H54P2Pd Molecular Weight (g/mol): 511.06 MDL Number: MFCD03094580 InChI Key: MXQOYLRVSVOCQT-UHFFFAOYSA-N Synonym: bis tri-tert-butylphosphine palladium 0,bis tri-t-butylphosphine palladium 0,bis tri-tert-butylphosphine palladium,bis tri-tert-butylphosphane palladium,palladium; tritert-butylphosphane,palladium, bis tris 1,1-dimethylethyl phosphine,pd p tbu 3 2,pd t-bu3p 2,bis tri-t-butylphosphine palladium,di tri-tert-butylphosphine palladium 0 PubChem CID: 2734558 SMILES: [Pd].CC(C)(C)P(C(C)(C)C)C(C)(C)C.CC(C)(C)P(C(C)(C)C)C(C)(C)C
| PubChem CID | 2734558 |
|---|---|
| CAS | 53199-31-8 |
| Molecular Weight (g/mol) | 511.06 |
| MDL Number | MFCD03094580 |
| SMILES | [Pd].CC(C)(C)P(C(C)(C)C)C(C)(C)C.CC(C)(C)P(C(C)(C)C)C(C)(C)C |
| Synonym | bis tri-tert-butylphosphine palladium 0,bis tri-t-butylphosphine palladium 0,bis tri-tert-butylphosphine palladium,bis tri-tert-butylphosphane palladium,palladium; tritert-butylphosphane,palladium, bis tris 1,1-dimethylethyl phosphine,pd p tbu 3 2,pd t-bu3p 2,bis tri-t-butylphosphine palladium,di tri-tert-butylphosphine palladium 0 |
| InChI Key | MXQOYLRVSVOCQT-UHFFFAOYSA-N |
| Molecular Formula | C24H54P2Pd |
Bis[1,2-bis(diphenylphosphino)ethane]palladium(0)
CAS: 31277-98-2 Molecular Formula: C52H48P4Pd Molecular Weight (g/mol): 903.27 MDL Number: MFCD00009880 InChI Key: FAFGMAGIYHHRKN-UHFFFAOYSA-N Synonym: bis 1,2-bis diphenylphosphino ethane palladium 0,pd dppe 2,pd diphos 2,bis diphos palladium 0,bis 1,2-bis diphenylphosphino ethane palladium,bis diphos palladium,bis 1,2-bis diphenylphosphino ethane-palladium 0,bis 1,2-bis diphenylphosphino ethane-palladium PubChem CID: 2724231 IUPAC Name: 2-diphenylphosphanylethyl(diphenyl)phosphane;palladium SMILES: [Pd].C(CP(C1=CC=CC=C1)C1=CC=CC=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C(CP(C1=CC=CC=C1)C1=CC=CC=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 2724231 |
|---|---|
| CAS | 31277-98-2 |
| Molecular Weight (g/mol) | 903.27 |
| MDL Number | MFCD00009880 |
| SMILES | [Pd].C(CP(C1=CC=CC=C1)C1=CC=CC=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C(CP(C1=CC=CC=C1)C1=CC=CC=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | bis 1,2-bis diphenylphosphino ethane palladium 0,pd dppe 2,pd diphos 2,bis diphos palladium 0,bis 1,2-bis diphenylphosphino ethane palladium,bis diphos palladium,bis 1,2-bis diphenylphosphino ethane-palladium 0,bis 1,2-bis diphenylphosphino ethane-palladium |
| IUPAC Name | 2-diphenylphosphanylethyl(diphenyl)phosphane;palladium |
| InChI Key | FAFGMAGIYHHRKN-UHFFFAOYSA-N |
| Molecular Formula | C52H48P4Pd |
Bis(3,5,3',5'-dimethoxydibenzylideneacetone)palladium(0), 97%
CAS: 811862-77-8 Molecular Formula: C42H44O10Pd Molecular Weight (g/mol): 815.22 MDL Number: MFCD07369799 InChI Key: RTGAJOPJZJDWAX-UHFFFAOYSA-N Synonym: bis 3,5,3',5'-dimethoxydibenzylideneacetone palladium 0,pd dmdba 2,bis 353'5'-dimethoxydibenzylideneace,bis 3,5,3',5'-dimethoxydibenzylideneacetone palladium PubChem CID: 24777333 SMILES: [Pd].COC1=CC(C=CC(=O)C=CC2=CC(OC)=CC(OC)=C2)=CC(OC)=C1.COC1=CC(C=CC(=O)C=CC2=CC(OC)=CC(OC)=C2)=CC(OC)=C1
| PubChem CID | 24777333 |
|---|---|
| CAS | 811862-77-8 |
| Molecular Weight (g/mol) | 815.22 |
| MDL Number | MFCD07369799 |
| SMILES | [Pd].COC1=CC(C=CC(=O)C=CC2=CC(OC)=CC(OC)=C2)=CC(OC)=C1.COC1=CC(C=CC(=O)C=CC2=CC(OC)=CC(OC)=C2)=CC(OC)=C1 |
| Synonym | bis 3,5,3',5'-dimethoxydibenzylideneacetone palladium 0,pd dmdba 2,bis 353'5'-dimethoxydibenzylideneace,bis 3,5,3',5'-dimethoxydibenzylideneacetone palladium |
| InChI Key | RTGAJOPJZJDWAX-UHFFFAOYSA-N |
| Molecular Formula | C42H44O10Pd |
Tetrakis(triphenylphosphine)palladium(0), 99.8% (metals basis), Pd 9% min
CAS: 14221-01-3 Molecular Formula: C72H60P4Pd Molecular Weight (g/mol): 1155.59 MDL Number: MFCD00010012 InChI Key: NFHFRUOZVGFOOS-UHFFFAOYSA-N PubChem CID: 11979704 SMILES: [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 11979704 |
|---|---|
| CAS | 14221-01-3 |
| Molecular Weight (g/mol) | 1155.59 |
| MDL Number | MFCD00010012 |
| SMILES | [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| InChI Key | NFHFRUOZVGFOOS-UHFFFAOYSA-N |
| Molecular Formula | C72H60P4Pd |
Tetrakis(triphenylphosphine)palladium(0), 99.9%, (trace metal basis)
CAS: 14221-01-3 Molecular Formula: C72H60P4Pd Molecular Weight (g/mol): 1155.59 MDL Number: MFCD00010012 InChI Key: NFHFRUOZVGFOOS-UHFFFAOYSA-N Synonym: tetrakis triphenylphosphine palladium,tetrakis triphenylphosphine palladium 0,pd pph3 4,tetrakis triphenylphosphine palladium o,tetra triphenylphosphine palladium,palladium-tetrakis triphenylphosphine,palladium 0 tetrakis triphenylphosphine,palladium, tetrakis triphenylphosphine-, t-4 PubChem CID: 11979704 IUPAC Name: palladium;triphenylphosphane SMILES: [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 11979704 |
|---|---|
| CAS | 14221-01-3 |
| Molecular Weight (g/mol) | 1155.59 |
| MDL Number | MFCD00010012 |
| SMILES | [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | tetrakis triphenylphosphine palladium,tetrakis triphenylphosphine palladium 0,pd pph3 4,tetrakis triphenylphosphine palladium o,tetra triphenylphosphine palladium,palladium-tetrakis triphenylphosphine,palladium 0 tetrakis triphenylphosphine,palladium, tetrakis triphenylphosphine-, t-4 |
| IUPAC Name | palladium;triphenylphosphane |
| InChI Key | NFHFRUOZVGFOOS-UHFFFAOYSA-N |
| Molecular Formula | C72H60P4Pd |
Bis(tri-o-tolylphosphine)palladium(0), Pd 14.9%
CAS: 69861-71-8 Molecular Formula: C42H42P2Pd Molecular Weight (g/mol): 715.166 MDL Number: MFCD12911908 InChI Key: CUBIJGNGGJBNOC-UHFFFAOYSA-N Synonym: bis tri-o-tolylphosphine palladium 0,pd o-tol 3p 2,bis tris 2-methylphenyl phosphine palladium,bis tris 2-tolyl phosphine palladium,palladium, bis tris 2-methylphenyl phosphine,bis tris 2-methylphenyl phosphane palladium PubChem CID: 10952654 IUPAC Name: palladium;tris(2-methylphenyl)phosphane SMILES: CC1=CC=CC=C1P(C2=CC=CC=C2C)C3=CC=CC=C3C.CC1=CC=CC=C1P(C2=CC=CC=C2C)C3=CC=CC=C3C.[Pd]
| PubChem CID | 10952654 |
|---|---|
| CAS | 69861-71-8 |
| Molecular Weight (g/mol) | 715.166 |
| MDL Number | MFCD12911908 |
| SMILES | CC1=CC=CC=C1P(C2=CC=CC=C2C)C3=CC=CC=C3C.CC1=CC=CC=C1P(C2=CC=CC=C2C)C3=CC=CC=C3C.[Pd] |
| Synonym | bis tri-o-tolylphosphine palladium 0,pd o-tol 3p 2,bis tris 2-methylphenyl phosphine palladium,bis tris 2-tolyl phosphine palladium,palladium, bis tris 2-methylphenyl phosphine,bis tris 2-methylphenyl phosphane palladium |
| IUPAC Name | palladium;tris(2-methylphenyl)phosphane |
| InChI Key | CUBIJGNGGJBNOC-UHFFFAOYSA-N |
| Molecular Formula | C42H42P2Pd |
Bis(di-tert-butyl-phenylphosphine)palladium(0), 98%
CAS: 52359-17-8 Molecular Formula: C28H46P2Pd Molecular Weight (g/mol): 551.04 MDL Number: MFCD15071400 InChI Key: KJTQUBRAVOMHKY-UHFFFAOYSA-N Synonym: palladium, bis bis 1,1-dimethylethyl phenylphosphine,di-tert-butyl phenyl phosphane-palladium 2/1,bis di-tert-butyl phenyl phosphane palladium PubChem CID: 71365671 IUPAC Name: ditert-butyl(phenyl)phosphane;palladium SMILES: [Pd].CC(C)(C)P(C1=CC=CC=C1)C(C)(C)C.CC(C)(C)P(C1=CC=CC=C1)C(C)(C)C
| PubChem CID | 71365671 |
|---|---|
| CAS | 52359-17-8 |
| Molecular Weight (g/mol) | 551.04 |
| MDL Number | MFCD15071400 |
| SMILES | [Pd].CC(C)(C)P(C1=CC=CC=C1)C(C)(C)C.CC(C)(C)P(C1=CC=CC=C1)C(C)(C)C |
| Synonym | palladium, bis bis 1,1-dimethylethyl phenylphosphine,di-tert-butyl phenyl phosphane-palladium 2/1,bis di-tert-butyl phenyl phosphane palladium |
| IUPAC Name | ditert-butyl(phenyl)phosphane;palladium |
| InChI Key | KJTQUBRAVOMHKY-UHFFFAOYSA-N |
| Molecular Formula | C28H46P2Pd |
Bis[di-tert-butyl(4-dimethylaminophenyl)phosphine]palladium(0), Pd 16.7%
CAS: 1233717-68-4 Molecular Formula: C32H56N2P2Pd Molecular Weight (g/mol): 637.182 MDL Number: MFCD15071402 InChI Key: SSPOQURGNAWORH-UHFFFAOYSA-N Synonym: bis di-tert-butyl 4-dimethylaminophenyl phosphine palladium 0,bis 4-n,n-dimethylamino phenyl di-t-butylphosphino palladium 0,bis 4-di-tert-butylphosphanyl-n,n-dimethylaniline palladium PubChem CID: 46900632 IUPAC Name: 4-ditert-butylphosphanyl-N,N-dimethylaniline;palladium SMILES: CC(C)(C)P(C1=CC=C(C=C1)N(C)C)C(C)(C)C.CC(C)(C)P(C1=CC=C(C=C1)N(C)C)C(C)(C)C.[Pd]
| PubChem CID | 46900632 |
|---|---|
| CAS | 1233717-68-4 |
| Molecular Weight (g/mol) | 637.182 |
| MDL Number | MFCD15071402 |
| SMILES | CC(C)(C)P(C1=CC=C(C=C1)N(C)C)C(C)(C)C.CC(C)(C)P(C1=CC=C(C=C1)N(C)C)C(C)(C)C.[Pd] |
| Synonym | bis di-tert-butyl 4-dimethylaminophenyl phosphine palladium 0,bis 4-n,n-dimethylamino phenyl di-t-butylphosphino palladium 0,bis 4-di-tert-butylphosphanyl-n,n-dimethylaniline palladium |
| IUPAC Name | 4-ditert-butylphosphanyl-N,N-dimethylaniline;palladium |
| InChI Key | SSPOQURGNAWORH-UHFFFAOYSA-N |
| Molecular Formula | C32H56N2P2Pd |
Tetrakis(triphenylphosphine)palladium(0), TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
Tris(dibenzylideneacetone)dipalladium(0), 97%
CAS: 51364-51-3 Molecular Formula: C51H42O3Pd2 Molecular Weight (g/mol): 915.73 MDL Number: MFCD00013310 InChI Key: CYPYTURSJDMMMP-UHFFFAOYSA-N Synonym: tris dibenzylideneacetone dipalladium 0,tris dibenzylideneacetone dipalladium,pd2 dba 3,tris dibezylideneacetone dipalladium,tris dibenzylideneacetone dipalladium o,tris dibenzylideneacetonyl bis-palladium,tris dba,tris 1e,4e-1,5-diphenylpenta-1,4-dien-3-one dipalladium PubChem CID: 9811564 IUPAC Name: (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one;palladium SMILES: [Pd].[Pd].O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1.O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1.O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1
| PubChem CID | 9811564 |
|---|---|
| CAS | 51364-51-3 |
| Molecular Weight (g/mol) | 915.73 |
| MDL Number | MFCD00013310 |
| SMILES | [Pd].[Pd].O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1.O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1.O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1 |
| Synonym | tris dibenzylideneacetone dipalladium 0,tris dibenzylideneacetone dipalladium,pd2 dba 3,tris dibezylideneacetone dipalladium,tris dibenzylideneacetone dipalladium o,tris dibenzylideneacetonyl bis-palladium,tris dba,tris 1e,4e-1,5-diphenylpenta-1,4-dien-3-one dipalladium |
| IUPAC Name | (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one;palladium |
| InChI Key | CYPYTURSJDMMMP-UHFFFAOYSA-N |
| Molecular Formula | C51H42O3Pd2 |