Learn More
Ethylmercurithiosalicylic acid, sodium salt, 97.0-101.0%, ACROS Organics™
Brand: Acros Organics 118680250
Additional Details : CAS : 54-64-8 Weight : 0.07500kg ??product.attributeSet.Transport?? : UN number : 2025 Chem class : 6.1 Pack group : II
| Packaging | Glass bottle |
|---|---|
| Quantity | 25g |
Chemical Identifiers
| 54-64-8 | |
| 404.81 | |
| RTKIYNMVFMVABJ-UHFFFAOYSA-L | |
| 16684434 | |
| sodium;(2-carboxylatophenyl)sulfanyl-ethylmercury |
| C9H9HgNaO2S | |
| MFCD00013062 | |
| thimerosal, thiomersal, thiomersalate, mercurothiolate, sodium merthiolate, sodium ethylmercurithiosalicylate, merthiolate, thimerosalate, thimerosalum, thimersalate | |
| CHEBI:9546 | |
| [Na+].CC[Hg]SC1=CC=CC=C1C([O-])=O |
Specifications
| Ethylmercurithiosalicylic acid, sodium salt | |
| 97.0-101.0% | |
| 2-(C2H5HgS)C6H4CO2Na | |
| 15, 9470 | |
| Solubility in water: 1g/1mL (20°C). Other solubilities: 1g/8mL in alcohol,1g/10mL in methanol,almost insoluble in ether and benzene | |
| [Na+].CC[Hg]SC1=CC=CC=C1C([O-])=O | |
| 404.81 | |
| CHEBI:9546 | |
| Powder | |
| Authentic | |
| ion mercuric: < 0.7% | |
| Solubility in water: 1g/1mL (20°C). Other solubilities: 1g/8mL in alcohol, 1g/10mL in methanol, almost insoluble in ether and benzene | |
| 232.0°C to 233.0°C | |
| 25g |
| 54-64-8 | |
| C9H9HgNaO2S | |
| MFCD00013062 | |
| thimerosal, thiomersal, thiomersalate, mercurothiolate, sodium merthiolate, sodium ethylmercurithiosalicylate, merthiolate, thimerosalate, thimerosalum, thimersalate | |
| RTKIYNMVFMVABJ-UHFFFAOYSA-L | |
| sodium;(2-carboxylatophenyl)sulfanyl-ethylmercury | |
| 16684434 | |
| 404.8 | |
| 97.0-101% | |
| 0.5% max. (vacuum/P2O5) | |
| Glass bottle | |
| Cream to White | |
| 6 to 8 (1% soln.) | |
| 250°C |