Learn More
Bromocresol Green, sodium salt, ACROS Organics™
Marke: Acros Organics 402940050
Weitere Details : CAS : 67763-24-0 Gewicht : 0.05500kg
| Menge. | 5g |
|---|---|
| Verpackung | Glass bottle |
Chemische Identifikatoren
| 67763-24-0 | |
| 719.996 | |
| HEFSGAHJDGZCHA-UHFFFAOYSA-M | |
| 23675901 | |
| CC1=C(C(=C(C=C1C2(C3=CC=CC=C3S(=O)(=O)O2)C4=CC(=C(C(=C4C)Br)[O-])Br)Br)O)Br.[Na+] |
| C21H13Br4NaO5S | |
| MFCD00148898 | |
| 3',3'',5',5''-Tetrabromo-m-cresolsulfonephthalein sodium salt | |
| sodium;2,6-dibromo-4-[3-(3,5-dibromo-4-hydroxy-2-methylphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]-3-methylphenolate |
Spezifikation
| Bromocresol Green, sodium salt | |
| 67763-24-0 | |
| C21H13Br4NaO5S | |
| 3',3'',5',5''-Tetrabromo-m-cresolsulfonephthalein sodium salt | |
| Authentic | |
| sodium;2,6-dibromo-4-[3-(3,5-dibromo-4-hydroxy-2-methylphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]-3-methylphenolate | |
| 23675901 | |
| Powder | |
| Glass bottle | |
| Black to Brown-Green |
| Pure | |
| Passes Test | |
| MFCD00148898 | |
| HEFSGAHJDGZCHA-UHFFFAOYSA-M | |
| CC1=C(C(=C(C=C1C2(C3=CC=CC=C3S(=O)(=O)O2)C4=CC(=C(C(=C4C)Br)[O-])Br)Br)O)Br.[Na+] | |
| 719.996 | |
| 720 | |
| ACS Reagent | |
| from pH 3.8 (yellow) to pH 5.4 (blue) | |
| 5g |