Learn More
Bis(trimethylsilyl) malonate, 98%, ACROS Organics™
Brand: Acros Organics 313300500
Additional Details : CAS : 18457-04-0 Weight : 0.10000kg ??product.attributeSet.Transport?? : UN number : 3272 Chem class : 3 Pack group : III
| Packaging | Glass bottle |
|---|---|
| Quantity | 50g |
Chemical Identifiers
| 18457-04-0 | |
| 248.43 | |
| ATCKJLDGNXGLAO-UHFFFAOYSA-N | |
| 87656 | |
| C[Si](C)(C)OC(=O)CC(=O)O[Si](C)(C)C |
| C9H20O4Si2 | |
| MFCD00009631 | |
| bis trimethylsilyl malonate, malonic acid bis trimethylsilyl ester, propanedioic acid, bis trimethylsilyl ester, malonic acid, bis trimethylsilyl ester, malonic acid ditms, malonic acid 2tms, malonic acid, bis-tms, bis trimethylsilyl malonat, malonic acid bis-tms, acmc-1c3vy | |
| bis(trimethylsilyl) propanedioate |
Specifications
| Bis(trimethylsilyl) malonate | |
| 23°C | |
| Glass bottle | |
| 0.972 | |
| Colorless to Straw | |
| 18457-04-0 | |
| C9H20O4Si2 | |
| MFCD00009631 | |
| Solubility in water: reacts | |
| C[Si](C)(C)OC(=O)CC(=O)O[Si](C)(C)C | |
| 248.43 | |
| 248.43 | |
| 98% |
| 0.9720g/mL | |
| Authentic | |
| 1.4150 to 1.417 | |
| 63°C to 66°C (1.0mmHg) | |
| 50g | |
| 96% min. (GC) | |
| (CH3)3SiOC(O)CH2C(O)OSi(CH3)3 | |
| bis trimethylsilyl malonate, malonic acid bis trimethylsilyl ester, propanedioic acid, bis trimethylsilyl ester, malonic acid, bis trimethylsilyl ester, malonic acid ditms, malonic acid 2tms, malonic acid, bis-tms, bis trimethylsilyl malonat, malonic acid bis-tms, acmc-1c3vy | |
| ATCKJLDGNXGLAO-UHFFFAOYSA-N | |
| bis(trimethylsilyl) propanedioate | |
| 87656 | |
| Liquid |