Learn More
4-Methyl-3-nitrobenzoic acid, 99%, ACROS Organics™
Brand: Acros Organics 165991000
Additional Details : CAS : 96-98-0 Weight : 0.26000kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 100g |
Chemical Identifiers
| 96-98-0 | |
| 181.15 | |
| BBEWSMNRCUXQRF-UHFFFAOYSA-N | |
| 7319 |
| C8H7NO4 | |
| MFCD00007174 | |
| 4-methyl-3-nitrobenzoic acid, 3-nitro-4-methylbenzoic acid, 3-nitro-p-toluic acid, benzoic acid, 4-methyl-3-nitro, 3-nitro-para-toluic acid, m-nitro-p-toluic acid, 4-methyl-3-nitro-benzoic acid, p-toluic acid, 3-nitro, 3-nitro-4-methyl benzoic acid, benzoic acid,4-methyl-3-nitro | |
| CC1=C(C=C(C=C1)C(=O)O)[N+](=O)[O-] |
Specifications
| 4-Methyl-3-nitrobenzoic acid | |
| Glass bottle | |
| 187.0°C to 190.0°C | |
| 99% | |
| 98.5 | |
| 99% | |
| CH3C6H3(NO2)CO2H | |
| 09, 502 | |
| Solubility in water: slightly soluble. Other solubilities: soluble in alcohols | |
| CC1=C(C=C(C=C1)C(=O)O)[N+](=O)[O-] | |
| 7319 | |
| Crystalline Powder |
| Authentic | |
| White to Yellow | |
| 100g | |
| 96-98-0 | |
| 100.0 | |
| C8H7NO4 | |
| MFCD00007174 | |
| 4-methyl-3-nitrobenzoic acid, 3-nitro-4-methylbenzoic acid, 3-nitro-p-toluic acid, benzoic acid, 4-methyl-3-nitro, 3-nitro-para-toluic acid, m-nitro-p-toluic acid, 4-methyl-3-nitro-benzoic acid, p-toluic acid, 3-nitro, 3-nitro-4-methyl benzoic acid, benzoic acid,4-methyl-3-nitro | |
| BBEWSMNRCUXQRF-UHFFFAOYSA-N | |
| 181.15 | |
| 181.15 | |
| 99% |