Learn More
3,4-Dimethoxycinnamic acid, 99%, predominantly trans isomer, ACROS Organics™
Brand: Acros Organics 115510250
Additional Details : CAS : 2316-26-9 Weight : 0.07500kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 25g |
Chemical Identifiers
| 2316-26-9 | |
| 208.21 | |
| HJBWJAPEBGSQPR-GQCTYLIASA-N | |
| 717531 | |
| (E)-3-(3,4-dimethoxyphenyl)prop-2-enoic acid |
| C11H12O4 | |
| MFCD00004387 | |
| 3,4-dimethoxycinnamic acid, dimethylcaffeic acid, caffeic acid dimethyl ether, 2e-3-3,4-dimethoxyphenyl prop-2-enoic acid, dimethyl caffeic acid, e-3-3,4-dimethoxyphenyl acrylic acid, e-3,4-dimethoxycinnamic acid, unii-bvz841pvjl, 2e-3-3,4-dimethoxyphenyl acrylic acid, 3-3,4-dimethoxyphenyl acrylic acid | |
| CHEBI:86549 | |
| COC1=C(C=C(C=C1)C=CC(=O)O)OC |
Specifications
| 3, 4-Dimethoxycinnamic acid | |
| Glass bottle | |
| 181°C to 184°C | |
| 99% | |
| 98.5 | |
| 98.5% min. (GC) | |
| (CH3O)2C6H3CH=CHCO2H | |
| 10, 437 | |
| HJBWJAPEBGSQPR-GQCTYLIASA-N | |
| (E)-3-(3,4-dimethoxyphenyl)prop-2-enoic acid | |
| 717531 | |
| 208.21 | |
| 99% |
| Authentic | |
| Yellow to Beige | |
| 25g | |
| 2316-26-9 | |
| 100.0 | |
| C11H12O4 | |
| MFCD00004387 | |
| 3,4-dimethoxycinnamic acid, dimethylcaffeic acid, caffeic acid dimethyl ether, 2e-3-3,4-dimethoxyphenyl prop-2-enoic acid, dimethyl caffeic acid, e-3-3,4-dimethoxyphenyl acrylic acid, e-3,4-dimethoxycinnamic acid, unii-bvz841pvjl, 2e-3-3,4-dimethoxyphenyl acrylic acid, 3-3,4-dimethoxyphenyl acrylic acid | |
| COC1=C(C=C(C=C1)C=CC(=O)O)OC | |
| 208.21 | |
| CHEBI:86549 | |
| Powder |
Safety and Handling
- 3,4-Dimethoxycinnamic acid
Signal Word
- Warning
Hazard Category
- Serious eye damage/eye irritation Category 2
- Skin corrosion/irritation Category 2
- Specific target organ toxicity Category 3
Hazard Statement
- H319-Causes serious eye irritation.
- H335-May cause respiratory irritation.
- H315-Causes skin irritation.
Precautionary Statement
- P261-Avoid breathing dust/fume/gas/mist/vapours/spray.
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P302+P352-IF ON SKIN: Wash with plenty of water/.
- P305+P351+P338-IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.