Learn More
2,3,4,5,6-Pentafluoroaniline, 97%, ACROS Organics™
Brand: Acros Organics 147080500
Additional Details : CAS : 771-60-8 Weight : 0.10000kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 50g |
Chemical Identifiers
| 771-60-8 | |
| 183.08 | |
| NOXLGCOSAFGMDV-UHFFFAOYSA-N | |
| 13040 | |
| NC1=C(F)C(F)=C(F)C(F)=C1F |
| C6H2F5N | |
| MFCD00007643 | |
| pentafluoroaniline, pentafluorophenylamine, aminopentafluorobenzene, benzenamine, 2,3,4,5,6-pentafluoro, 2,3,4,5,6-pentafluorobenzenamine, aniline, 2,3,4,5,6-pentafluoro, unii-ms06il3y2q, ms06il3y2q, 2,3,4,5,6-pentafluorophenylamine, pubchem1546 | |
| 2,3,4,5,6-pentafluoroaniline |
Specifications
| 2,3,4,5,6-Pentafluoroaniline | |
| Authentic | |
| Salmon to White | |
| 50g | |
| 96.0 | |
| 97% | |
| C6F5NH2 | |
| pentafluoroaniline, pentafluorophenylamine, aminopentafluorobenzene, benzenamine, 2,3,4,5,6-pentafluoro, 2,3,4,5,6-pentafluorobenzenamine, aniline, 2,3,4,5,6-pentafluoro, unii-ms06il3y2q, ms06il3y2q, 2,3,4,5,6-pentafluorophenylamine, pubchem1546 | |
| NC1=C(F)C(F)=C(F)C(F)=C1F | |
| 183.08 | |
| 183.08 | |
| ≥96.0% |
| 73g/mL | |
| Glass bottle | |
| 33°C to 38°C | |
| 771-60-8 | |
| 100.0 | |
| C6H2F5N | |
| MFCD00007643 | |
| NOXLGCOSAFGMDV-UHFFFAOYSA-N | |
| 2,3,4,5,6-pentafluoroaniline | |
| 13040 | |
| Crystalline Low Melting Solid |
Safety and Handling
- 2,3,4,5,6-Pentafluoroaniline
Signal Word
- Warning
Hazard Category
- Serious eye damage/eye irritation Category 2
- Skin corrosion/irritation Category 2
- Specific target organ toxicity Category 3
Hazard Statement
- H319-Causes serious eye irritation.
- H335-May cause respiratory irritation.
- H315-Causes skin irritation.
Precautionary Statement
- P261-Avoid breathing dust/fume/gas/mist/vapours/spray.
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P301+P312-IF SWALLOWED: Call a POISON CENTER or doctor/physician/ if you feel unwell.
- P302+P352-IF ON SKIN: Wash with plenty of water/.
- P305+P351+P338-IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.